CAS 29014-72-0

2-Butenedioic acid (2Z)-, 1,4-dibutyl ester, homopolymer

Description:

2-Butenedioic acid (2Z)-, 1,4-dibutyl ester, homopolymer, commonly referred to as poly(butylene succinate), is a biodegradable polymer derived from the polymerization of butenedioic acid and butanol. This substance exhibits characteristics typical of aliphatic polyesters, including good mechanical properties, flexibility, and thermal stability. It is known for its biodegradability, making it an environmentally friendly alternative to conventional plastics. The polymer typically has a moderate glass transition temperature, which allows it to maintain flexibility at room temperature. Its solubility in organic solvents varies, and it is generally insoluble in water. The material is often used in applications such as packaging, agricultural films, and disposable items due to its ability to decompose under natural conditions. Additionally, it can be processed using standard thermoplastic techniques, such as extrusion and injection molding. Overall, this polymer represents a significant advancement in sustainable materials, combining functionality with environmental responsibility.

Formula: (C₁₂H₂₀O₄)x

InChI: InChI=1S/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7-

InChI key: InChIKey=JBSLOWBPDRZSMB-FPLPWBNLSA-N

SMILES: C(/C=C\C(OCCCC)=O)(OCCCC)=O

Synonyms:

• 2-Butenedioic acid (Z)-, dibutyl ester, homopolymer
• 2-Butenedioic acid (2Z)-, dibutyl ester, homopolymer
• Poly(dibutyl maleate)
• Maleic acid, dibutyl ester, polymers
• 2-Butenedioic acid (2Z)-, 1,4-dibutyl ester, homopolymer

2-Butenedioic acid (2Z)-, 1,4-dibutyl ester, homopolymer

CAS: 29014-72-0

Formula: C₁₂H₂₀O₄

Molecular weight: 228.2848

Ref: IN-DA01X3B9