CAS 29025-67-0

1-(4-Chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane

Description:

1-(4-Chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane, with CAS number 29025-67-0, is a complex organic compound that features a bicyclic structure incorporating both silicon and nitrogen atoms, along with multiple oxygen atoms. The presence of the 4-chlorophenyl group indicates that the compound has a phenyl ring substituted with a chlorine atom, which can influence its chemical reactivity and biological activity. The bicyclic framework suggests potential applications in medicinal chemistry, particularly due to the unique properties imparted by the silicon and nitrogen atoms. The compound may exhibit interesting solubility characteristics and stability, influenced by the functional groups present. Additionally, the presence of multiple heteroatoms (nitrogen and oxygen) can contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Overall, this compound's structural features suggest it may have diverse applications in pharmaceuticals or materials science, although specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.

Formula: C₁₂H₁₆ClNO₃Si

InChI: InChI=1S/C12H16ClNO3Si/c13-11-1-3-12(4-2-11)18-15-8-5-14(6-9-16-18)7-10-17-18/h1-4H,5-10H2

InChI key: InChIKey=IKFVTMCLFHXPQF-UHFFFAOYSA-N

SMILES: ClC1=CC=C([Si]23OCCN(CCO2)CCO3)C=C1

1-(4-Chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane

CAS: 29025-67-0

1-(4-Chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane is an analog of gamma-aminobutyric acid (GABA) that has been shown to have convulsant activity in rats and exhibits functional correlations with GABA in the cerebral cortex. 1-(4-Chlorophenyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane is taken up by cells through a chloride channel and can induce chloride efflux from cells in the cerebral cortex. It also inhibits uptake of gamma aminobutyric acid (GABA), which causes increased levels of GABA in the cerebral cortex and increased seizure activity.

Formula: C₁₂H₁₆ClNO₃Si

Purity: Min. 95%

Molecular weight: 285.8 g/mol

Ref: 3D-EBA02567