CAS 29030-81-7
:ethyl hexacosanoate
Description:
Ethyl hexacosanoate, with the CAS number 29030-81-7, is an ester formed from the reaction of hexacosanoic acid and ethanol. It is characterized by its long carbon chain, consisting of 26 carbon atoms, which contributes to its hydrophobic nature and low solubility in water. This compound typically appears as a colorless to pale yellow liquid with a waxy texture and a mild, fatty odor. Ethyl hexacosanoate is known for its applications in the fragrance and flavor industry, where it is used to impart a pleasant aroma to various products. Additionally, due to its long-chain structure, it may exhibit properties such as high viscosity and stability under various conditions. Its low volatility and high molecular weight make it suitable for use in formulations requiring long-lasting effects. As with many esters, it may also have potential applications in cosmetics and personal care products, where it can serve as an emollient or skin-conditioning agent.
Formula:C28H56O2
InChI:InChI=1/C28H56O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30-4-2/h3-27H2,1-2H3
SMILES:CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC
Synonyms:- Hexacosanoic Acid, Ethyl Ester
- Ethyl hexacosanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hexacosanoic Acid Ethyl Ester-d5
CAS:Controlled ProductFormula:C28H51D5O2Color and Shape:NeatMolecular weight:884.363Hexacosanoic Acid Ethyl Ester
CAS:Controlled Product<p>Applications Hexacosanoic Acid Ethyl Ester is the ethyl ester derivative of Hexacosanoic Acid (H290910) and is reported to be a grape constituent.<br>References Radulovic, N., et al.: J. Essent. Oil Res., 22, 616 (2010)<br></p>Formula:C28H56O2Color and Shape:NeatMolecular weight:424.74


