CAS 290306-56-8

2-bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrrole

Description:

2-bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrrole is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a bromine atom and a sulfonyl group attached to a para-methylphenyl moiety. This compound typically exhibits properties associated with both the pyrrole and sulfonyl functional groups, such as potential reactivity in electrophilic substitution reactions due to the presence of the bromine atom. The sulfonyl group can enhance the compound's solubility in polar solvents and may also influence its biological activity. Additionally, the presence of the methyl group on the phenyl ring can affect the compound's steric and electronic properties, potentially impacting its interactions in biological systems or chemical reactions. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and solubility, can vary based on the purity and specific conditions under which the compound is studied. Overall, this compound may have applications in medicinal chemistry or materials science, depending on its reactivity and functional properties.

Formula: C₁₁H₁₀BrNO₂S

InChI: InChI=1/C11H10BrNO2S/c1-9-4-6-10(7-5-9)16(14,15)13-8-2-3-11(13)12/h2-8H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)n1cccc1Br

Synonyms:

• 2-Bromo-1-(toluene-4-sulphonyl)-1H-pyrrole
• 2-Bromo-1-[(4-methylphenyl)sulphonyl]-1H-pyrrole

1H-Pyrrole, 2-bromo-1-[(4-methylphenyl)sulfonyl]-

CAS: 290306-56-8

Formula: C₁₁H₁₀BrNO₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 300.1716

Ref: IN-DA002V93

2-Bromo-1-(toluene-4-sulphonyl)-1H-pyrrole

CAS: 290306-56-8

2-Bromo-1-(toluene-4-sulphonyl)-1H-pyrrole

Purity: 96%

Color and Shape: Powder

Molecular weight: 300.17g/mol

Ref: 54-OR8606

2-Bromo-N-(p-toluenesulfonyl)pyrrole

CAS: 290306-56-8

Purity: 96%

Molecular weight: 300.1700134

Ref: 10-F635277