CAS 290313-19-8: 4-cyclohexyl-2-mercapto-6-oxo-1,6-dihydropyrimidine-5-carbonitrile

Description:4-Cyclohexyl-2-mercapto-6-oxo-1,6-dihydropyrimidine-5-carbonitrile is a heterocyclic compound characterized by its pyrimidine core, which features a cyclohexyl group and a mercapto (-SH) functional group. The presence of the carbonitrile (-C≡N) group adds to its reactivity and potential applications in organic synthesis. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its structure suggests potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. The mercapto group can participate in various chemical reactions, including nucleophilic substitutions and redox reactions, enhancing its utility in synthetic pathways. Additionally, the compound's unique combination of functional groups may contribute to its potential as a ligand in coordination chemistry or as an intermediate in the synthesis of more complex molecules. Overall, 4-cyclohexyl-2-mercapto-6-oxo-1,6-dihydropyrimidine-5-carbonitrile represents a versatile scaffold for further chemical exploration.

Formula:C₁₁H₁₃N₃OS

InChI:InChI=1/C11H13N3OS/c12-6-8-9(7-4-2-1-3-5-7)13-11(16)14-10(8)15/h7H,1-5H2,(H2,13,14,15,16)

Synonyms:
6-Cyclohexyl-4-Oxo-2-Thioxo-1,2,3,4-Tetrahydropyrimidine-5-Carbonitrile

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-Pyrimidinecarbonitrile, 6-cyclohexyl-1,2,3,4-tetrahydro-4-oxo-2-thioxo- REF: IN-DA002VA2CAS: 290313-19-8	- - -	To inquire	Tue 15 Apr 25
5-Cyano-6-cyclohexyl-2-thiouracil REF: 54-OR0307CAS: 290313-19-8	97%	93.00 €~230.00 €	Mon 14 Apr 25
4-cyclohexyl-2-mercapto-6-oxo-1,6-dihydropyrimidine-5-carbonitrile REF: 10-F518905CAS: 290313-19-8	97%	- - -	Discontinued product
5-Cyano-6-cyclohexyl-2-thiouracil REF: 3D-QLA31319CAS: 290313-19-8	Min. 95%	- - -	Discontinued product