CAS 290331-71-4

[1-(tert-butoxycarbonyl)-5-methoxy-1H-indol-2-yl]boronic acid

Description:

[1-(tert-butoxycarbonyl)-5-methoxy-1H-indol-2-yl]boronic acid is a boronic acid derivative characterized by its unique structural features, which include an indole core substituted with a tert-butoxycarbonyl (Boc) group and a methoxy group. This compound typically exhibits properties associated with both boronic acids and indole derivatives, such as the ability to form reversible covalent bonds with diols, making it useful in various organic synthesis applications, including drug development and materials science. The presence of the boronic acid functional group allows for participation in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Additionally, the Boc protecting group can be removed under acidic conditions, enabling further functionalization of the indole moiety. The methoxy group may influence the compound's solubility and reactivity. Overall, this compound is of interest in medicinal chemistry and synthetic organic chemistry due to its versatile reactivity and potential applications in creating complex molecular architectures.

Formula: C₁₄H₁₈BNO₅

InChI: InChI=1/C14H18BNO5/c1-14(2,3)21-13(17)16-11-6-5-10(20-4)7-9(11)8-12(16)15(18)19/h5-8,18-19H,1-4H3

SMILES: CC(C)(C)OC(=O)n1c2ccc(cc2cc1B(O)O)OC

Synonyms:

• 1H-indole-1-carboxylic acid, 2-borono-5-methoxy-, 1,1-dimethylethyl ester

1-Boc-5-methoxyindole-2-boronic acid, 95%

CAS: 290331-71-4

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₄H₁₈BNO₅

Purity: 95%

Color and Shape: White to pale cream or pale yellow, Powder or crystalline powder or crystals and/or chunks

Molecular weight: 291.11

Ref: 02-H52654

1H-Indole-1-carboxylic acid, 2-borono-5-methoxy-, 1-(1,1-dimethylethyl) ester

CAS: 290331-71-4

Formula: C₁₄H₁₈BNO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 291.1074

Ref: IN-DA002V9R

5-Methoxy-1H-indole-2-boronic acid, N-BOC protected

CAS: 290331-71-4

5-Methoxy-1H-indole-2-boronic acid, N-BOC protected

Formula: C₁₄H₁₈BNO₅

Purity: 98%

Color and Shape: off white solid

Molecular weight: 291.11g/mol

Ref: 54-OR14256

N-Boc-5-Methoxyindole-2-boronic acid

CAS: 290331-71-4

Formula: C₁₄H₁₈BNO₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 291.11

Ref: 10-F225045