CAS 290332-99-9

(4-methoxy-1H-pyrrolo[2,3-b]pyridin-2-yl)methanol

Description:

(4-Methoxy-1H-pyrrolo[2,3-b]pyridin-2-yl)methanol is a chemical compound characterized by its unique pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. This compound features a methoxy group (-OCH3) at the 4-position of the pyrrole ring and a hydroxymethyl group (-CH2OH) attached to the nitrogen of the pyridine ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxymethyl group. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy group and the overall aromatic character of the fused ring system. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1/C9H10N2O2/c1-13-8-2-3-10-9-7(8)4-6(5-12)11-9/h2-4,12H,5H2,1H3,(H,10,11)

SMILES: COc1ccnc2c1cc(CO)[nH]2

{4-methoxy-1H-pyrrolo[2,3-b]pyridin-2-yl}methanol

CAS: 290332-99-9

Formula: C₉H₁₀N₂O₂

Purity: 97%

Molecular weight: 178.1879

Ref: IN-DA002V9P

(4-Methoxy-1H-pyrrolo[2,3-b]pyridin-2-yl)methanol

CAS: 290332-99-9

Purity: 97%

Molecular weight: 178.1909943

Ref: 10-F727461