
CAS 290347-51-2
:(2α,3β,5α,25R)-26-(β-D-Glucopyranosyloxy)-2,22-dihydroxyfurostan-3-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside
Description:
The chemical substance with the name "(2α,3β,5α,25R)-26-(β-D-Glucopyranosyloxy)-2,22-dihydroxyfurostan-3-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside" and CAS number "290347-51-2" is a complex glycoside derived from furostanol. It features multiple hydroxyl groups, which contribute to its solubility in polar solvents and its potential biological activity. The presence of glucopyranosyl and mannopyranosyl moieties indicates that it is a glycoside, which may enhance its pharmacological properties, such as increased bioavailability or specific interactions with biological targets. This compound is likely to exhibit various biological activities, including potential anti-inflammatory or anti-cancer effects, as suggested by similar compounds in the literature. Its structural complexity, characterized by multiple stereocenters and sugar units, may also influence its reactivity and interaction with enzymes or receptors. Overall, this substance represents a class of natural products that could have significant implications in medicinal chemistry and pharmacology.
Formula:C45H76O19
InChI:InChI=1S/C45H76O19/c1-18(17-58-40-37(55)35(53)32(50)28(15-46)61-40)8-11-45(57)19(2)30-27(64-45)13-24-22-7-6-21-12-26(25(48)14-44(21,5)23(22)9-10-43(24,30)4)60-42-39(36(54)33(51)29(16-47)62-42)63-41-38(56)34(52)31(49)20(3)59-41/h18-42,46-57H,6-17H2,1-5H3/t18-,19+,20+,21+,22-,23+,24+,25-,26-,27+,28-,29-,30+,31+,32-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42-,43+,44+,45?/m1/s1
InChI key:InChIKey=WROHFEWGWYQNPP-QURHSSNOSA-N
SMILES:C[C@@]12[C@]([C@]3([C@](CC1)([C@]4(C)[C@@](CC3)(C[C@@H](O[C@H]5[C@H](O[C@H]6[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O)[C@@H](CO)O5)[C@H](O)C4)[H])[H])[H])(C[C@]7([C@@]2([C@H](C)C(CC[C@H](CO[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)C)(O)O7)[H])[H])[H]
Synonyms:- β-D-Glucopyranoside, (2α,3β,5α,25R)-26-(β-D-glucopyranosyloxy)-2,22-dihydroxyfurostan-3-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-
- Trigoneoside Xb
- (2α,3β,5α,25R)-26-(β-D-Glucopyranosyloxy)-2,22-dihydroxyfurostan-3-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Trigoneoside Xb
CAS:Trigoneoside Xb is a natural product that can be used as a reference standard. The CAS number of Trigoneoside Xb is 290347-51-2.Formula:C45H76O19Color and Shape:SolidMolecular weight:921.084
