CAS 2904-57-6

Mesitonitrile N-Oxide

Description:

Mesitonitrile N-Oxide, with the CAS number 2904-57-6, is a chemical compound characterized by its unique structural features and reactivity. It is an organic nitrile oxide, which typically contains a nitrile group (–C≡N) and an N-oxide functional group (–N=O). This compound is known for its role in organic synthesis, particularly in the formation of isoxazoles and other heterocyclic compounds through cycloaddition reactions. Mesitonitrile N-Oxide is generally a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in polar organic solvents. Its reactivity is attributed to the presence of the nitrile and N-oxide functionalities, making it a useful intermediate in various chemical transformations. Additionally, it may exhibit some degree of toxicity, necessitating careful handling and appropriate safety measures during use. Overall, Mesitonitrile N-Oxide is a valuable compound in synthetic organic chemistry, contributing to the development of complex molecular architectures.

Formula: C₁₀H₁₁NO

InChI: InChI=1/C10H11NO/c1-7-4-8(2)10(6-11-12)9(3)5-7/h4-5H,1-3H3

SMILES: Cc1cc(C)c(C#[N+][O-])c(C)c1

Synonyms:

• 2,4,6-Trimethylbenzonitrile N-Oxide
• [(2,4,6-Trimethylphenyl)Methylidyne]Azane Oxide

2,4,6-Trimethylbenzonitrile N-oxide

CAS: 2904-57-6

Formula: C₁₀H₁₁NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.2004

Ref: IN-DA002VBN

2,4,6-Trimethylbenzonitrile N-Oxide

CAS: 2904-57-6

2,4,6-Trimethylbenzonitrile N-Oxide

Purity: ≥95%

Ref: 54-OR1043787

2,4,6-Trimethylbenzonitrile N-Oxide

CAS: 2904-57-6

Formula: C₁₀H₁₁NO

Molecular weight: 161.204

Ref: 10-F342155

Mesitonitrile N-Oxide

Controlled Product

CAS: 2904-57-6

Formula: C₁₀H₁₁NO

Color and Shape: Neat

Ref: TR-M258870

2,4,6-Trimethylbenzonitrile N-oxide

CAS: 2904-57-6

2,4,6-Trimethylbenzonitrile N-oxide is an unsaturated ketone that is synthesized from 2,4,6-trimethylbenzonitrile and magnesium metal. It is a chiral molecule that can be used for asymmetric synthesis. The reaction mechanism involves the formation of a Grignard reagent with the magnesium ion. This Grignard reagent reacts with norbornadiene to produce a nitrile oxide compound. The nitrile oxide then reacts with hydrogen peroxide in the presence of a catalyst to form the desired product. Irradiation of the reaction mixture can also be used to initiate this reaction.

Formula: C₁₀H₁₁NO

Purity: Min. 95%

Molecular weight: 161.2 g/mol

Ref: 3D-CAA90457