CAS 29043-07-0

3',4',5,5',6,7-Hexamethoxyflavone

Description:

3',4',5,5',6,7-Hexamethoxyflavone, with the CAS number 29043-07-0, is a synthetic flavonoid compound characterized by the presence of six methoxy groups attached to its flavone backbone. This structure contributes to its unique chemical properties, including enhanced solubility and potential bioactivity. The methoxy substitutions can influence the compound's antioxidant activity, making it of interest in various biological studies. Hexamethoxyflavone is often investigated for its potential therapeutic effects, including anti-inflammatory and anticancer properties. Additionally, its structural features may affect its interaction with biological targets, such as enzymes and receptors. The compound is typically studied in the context of natural product chemistry and pharmacology, where its effects on cellular processes and mechanisms of action are explored. As with many flavonoids, its stability and reactivity can be influenced by environmental factors, including pH and temperature. Overall, 3',4',5,5',6,7-Hexamethoxyflavone represents a significant compound in the realm of medicinal chemistry and natural product research.

Formula: C₂₁H₂₂O₈

InChI: InChI=1/C21H22O8/c1-23-15-7-11(8-16(24-2)19(15)26-4)13-9-12(22)18-14(29-13)10-17(25-3)20(27-5)21(18)28-6/h7-10H,1-6H3

SMILES: COc1cc(cc(c1OC)OC)c1cc(=O)c2c(cc(c(c2OC)OC)OC)o1

Synonyms:

• 5,6,7,3',4',5'-Hexamethoxyflavone
• 5,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one

3',4',5,5',6,7-Hexamethoxyflavone

CAS: 29043-07-0

3',4',5,5',6,7-Hexamethoxyflavone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.

Formula: C₂₁H₂₂O₈

Purity: (HPLC) ≥95%

Color and Shape: Powder

Molecular weight: 402.41

Ref: 11-1269

5,6,7-Trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one

CAS: 29043-07-0

Formula: C₂₁H₂₂O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 402.3946

Ref: IN-DA002VBC

3',4',5,5',6,7-Hexamethoxyflavone

CAS: 29043-07-0

3',4',5,5',6,7-Hexamethoxyflavone

Purity: ≥98%

Ref: 54-BUP22621

3',4',5,5',6,7-Hexamethoxyflavone

CAS: 29043-07-0

3',4',5,5',6,7-Hexamethoxyflavone is a flavonoid with antiprotozoal activity, inhibiting Trypanosoma brucei rhodesiense (IC50 21.3 μM).

Formula: C₂₁H₂₂O₈

Purity: 99.801%

Color and Shape: Solid

Molecular weight: 402.40

Ref: TM-TN2846

3',4',5',5,6,7-Hexamethoxyflavone

CAS: 29043-07-0

3',4',5',5,6,7-Hexamethoxyflavone is a polymethoxylated flavone, which is a type of phytochemical or secondary metabolite. It is primarily found in citrus fruits, particularly in the peels, where it serves as a protective compound. This flavone is notable for its complex structure featuring multiple methoxy groups.

Formula: C₂₁H₂₂O₈

Purity: Min. 95%

Color and Shape: White Clear Liquid

Molecular weight: 402.39 g/mol

Ref: 3D-FH66258