CAS 29043-07-0: 3',4',5,5',6,7-Hexamethoxyflavone
Description:3',4',5,5',6,7-Hexamethoxyflavone, with the CAS number 29043-07-0, is a synthetic flavonoid compound characterized by the presence of six methoxy groups attached to its flavone backbone. This structure contributes to its unique chemical properties, including enhanced solubility and potential bioactivity. The methoxy substitutions can influence the compound's antioxidant activity, making it of interest in various biological studies. Hexamethoxyflavone is often investigated for its potential therapeutic effects, including anti-inflammatory and anticancer properties. Additionally, its structural features may affect its interaction with biological targets, such as enzymes and receptors. The compound is typically studied in the context of natural product chemistry and pharmacology, where its effects on cellular processes and mechanisms of action are explored. As with many flavonoids, its stability and reactivity can be influenced by environmental factors, including pH and temperature. Overall, 3',4',5,5',6,7-Hexamethoxyflavone represents a significant compound in the realm of medicinal chemistry and natural product research.
Formula:C21H22O8
InChI:InChI=1/C21H22O8/c1-23-15-7-11(8-16(24-2)19(15)26-4)13-9-12(22)18-14(29-13)10-17(25-3)20(27-5)21(18)28-6/h7-10H,1-6H3
- Synonyms:
- 5,6,7,3',4',5'-Hexamethoxyflavone
- 5,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one