CAS 29043-48-9

5-Amino-2-methylbenzimidazole

Description:

5-Amino-2-methylbenzimidazole is an organic compound characterized by its benzimidazole structure, which consists of a fused benzene and imidazole ring. This compound features an amino group (-NH2) and a methyl group (-CH3) attached to the benzimidazole framework, specifically at the 5 and 2 positions, respectively. It is typically a white to off-white solid, and its solubility can vary depending on the solvent, often being more soluble in polar solvents. The presence of the amino group makes it a potential candidate for various chemical reactions, including those involving nucleophilic substitution and coupling reactions. This compound is of interest in pharmaceutical and biochemical research due to its potential biological activities, including antimicrobial and anticancer properties. Additionally, it may serve as an intermediate in the synthesis of other complex organic molecules. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₀ClN₃

InChI: InChI=1/C8H9N3.ClH/c1-5-10-7-3-2-6(9)4-8(7)11-5;/h2-4H,9H2,1H3,(H,10,11);1H

SMILES: Cc1nc2ccc(cc2[nH]1)N.Cl

Synonyms:

• 2-methyl-1H-benzimidazol-5-amine
• 2-methyl-1H-benzimidazol-5-amine hydrochloride (1:1)
• 2-Methyl-1H-benzoimidazol-5-ylamine

2-Methyl-1h-benzimidazol-6-amine

CAS: 29043-48-9

Formula: C₈H₉N₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 147.1772

Ref: IN-DA002VBB

2-Methyl-1H-benzoimidazol-5-ylamine

CAS: 29043-48-9

2-Methyl-1H-benzoimidazol-5-ylamine

Purity: 96%

Molecular weight: 147.18g/mol

Ref: 54-OR1005711

2-Methyl-1H-benzoimidazol-5-ylamine

CAS: 29043-48-9

Formula: C₈H₉N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.181

Ref: 10-F025065