CAS 29043-58-1
:2-chloro-N'-(diphenylmethylidene)acetohydrazide
Description:
2-Chloro-N'-(diphenylmethylidene)acetohydrazide, with the CAS number 29043-58-1, is a chemical compound that belongs to the class of hydrazides. It features a hydrazide functional group, which is characterized by the presence of a hydrazine moiety (-NH-NH2) linked to an acyl group. The compound contains a chloro substituent, which can influence its reactivity and solubility. The diphenylmethylidene group indicates the presence of a bulky aromatic structure, contributing to the compound's overall stability and potentially affecting its biological activity. This compound may exhibit various properties such as moderate solubility in organic solvents and potential reactivity towards electrophiles due to the presence of the hydrazide functional group. Its unique structure may also suggest applications in medicinal chemistry or as a precursor in organic synthesis. However, specific physical properties such as melting point, boiling point, and spectral data would need to be referenced from experimental studies or databases for precise characterization.
Formula:C15H13ClN2O
InChI:InChI=1/C15H13ClN2O/c16-11-14(19)17-18-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,17,19)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Chloro-N'-(diphenylmethylidene)acetohydrazide
CAS:2-Chloro-N'-(diphenylmethylidene)acetohydrazide is a β-lactam antibiotic that contains a 2-chloro-N'-hydrazino group and an acetamide substituent. It has been shown to be effective in the treatment of Gram-positive bacterial infections, such as MRSA and penicillin resistant Staphylococcus aureus, but not Gram negative bacteria. 2-Chloro-N'-(diphenylmethylidene)acetohydrazide has been used as a starting point for the synthesis of other antibiotics with improved activity against Gram negative bacteria. This drug is also active against Mycobacterium tuberculosis (Mtb), which causes tuberculosis in humans. The heterocycles substituents are responsible for its reactivity and biological properties.Formula:C15H13ClN2OPurity:Min. 95%Molecular weight:272.73 g/mol
