CAS 2905-82-0
:methyl 5-methoxysalicylate
Description:
Methyl 5-methoxysalicylate, with the CAS number 2905-82-0, is an organic compound that belongs to the class of salicylates. It is characterized by its methoxy and methyl ester functional groups, which contribute to its chemical properties and potential applications. This compound typically appears as a colorless to pale yellow liquid with a pleasant, sweet aroma, making it useful in the fragrance and flavor industries. Methyl 5-methoxysalicylate is known for its solubility in organic solvents, while being less soluble in water, which is a common trait among many esters. It exhibits mild anti-inflammatory and analgesic properties, which may be leveraged in topical formulations. Additionally, it can be synthesized through esterification reactions involving salicylic acid and methanol. Safety data indicates that, like many organic compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, methyl 5-methoxysalicylate is a versatile compound with applications in various fields, including cosmetics and pharmaceuticals.
Formula:C9H10O4
InChI:InChI=1/C9H10O4/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5,10H,1-2H3
SMILES:COc1ccc(c(c1)C(=O)OC)O
Synonyms:- Methyl 2-Hydroxy-5-Methoxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 5-Methoxysalicylate
CAS:Formula:C9H10O4Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:182.18Benzoic acid, 2-hydroxy-5-methoxy-, methyl ester
CAS:Formula:C9H10O4Purity:98%Color and Shape:LiquidMolecular weight:182.1733Methyl 2-hydroxy-5-methoxybenzoate
CAS:Methyl 2-hydroxy-5-methoxybenzoate is a carbonyl compound that has the chemical formula CH3OOC(OH)CH2COOH. It has fluorescence properties and can be used to make other compounds by intramolecular hydrogen transfer, photophysical, and preparative methods. Methyl 2-hydroxy-5-methoxybenzoate is used in the production of salicylic acid and its derivatives. This compound is also used as a precursor for other organic compounds. Methyl 2-hydroxy-5-methoxybenzoate can be prepared by the reaction of methanol with methyl chloroacetate in diethyl ether or oxygen gas. The yields are about 80%.Formula:C9H10O4Purity:Min. 90%Color and Shape:Clear LiquidMolecular weight:182.17 g/molMethyl 2-hydroxy-5-methoxybenzoate
CAS:Formula:C9H10O4Purity:95%Color and Shape:LiquidMolecular weight:182.175(Methyl-d3) 2-Hydroxy-5-methoxybenzoate
CAS:Controlled ProductFormula:C9D3H7O4Color and Shape:NeatMolecular weight:185.192





