
CAS 29050-11-1
:Seclazone
Description:
Seclazone, with the CAS number 29050-11-1, is a chemical compound that belongs to the class of sulfonamides, which are known for their antibacterial properties. It is characterized by its ability to inhibit bacterial growth by interfering with folic acid synthesis, a crucial metabolic pathway in many microorganisms. Seclazone is typically used in the treatment of various bacterial infections, particularly those caused by Gram-positive and some Gram-negative bacteria. The compound is often administered in a pharmaceutical formulation, and its efficacy can be influenced by factors such as dosage, route of administration, and the specific bacterial strain being targeted. In terms of physical properties, Seclazone is generally a solid at room temperature, with solubility in water and organic solvents varying based on its molecular structure. Safety and handling precautions are essential, as with many sulfonamides, due to potential allergic reactions and side effects. Overall, Seclazone represents a valuable tool in antimicrobial therapy, contributing to the broader field of medicinal chemistry.
Formula:C10H8ClNO3
InChI:InChI=1S/C10H8ClNO3/c11-6-1-2-8-7(5-6)10(13)12-9(15-8)3-4-14-12/h1-2,5,9H,3-4H2
InChI key:InChIKey=XWXVKXXKKLBDDJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC3N1OCC3)=CC=C(Cl)C2
Synonyms:- W 2352
- Seclazone
- 2H,9H-Isoxazolo[3,2-b][1,3]benzoxazin-9-one, 7-chloro-3,3a-dihydro-
- W 2354
- 7-Chloro-3,3a-dihydro-2H,9H-isoxazolo[3,2-b][1,3]benzoxazin-9-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Seclazone
CAS:Seclazone is a biochemical.Formula:C10H8ClNO3Color and Shape:SolidMolecular weight:225.63
