CAS 29054-80-6

1,1,1,3,5,5,5-Heptamethyl-3-propyltrisiloxane

Description:

1,1,1,3,5,5,5-Heptamethyl-3-propyltrisiloxane, with the CAS number 29054-80-6, is a siloxane compound characterized by its unique structure, which includes a trisiloxane backbone and multiple methyl groups. This compound typically exhibits low viscosity and high thermal stability, making it suitable for various applications, including as a lubricant, surfactant, or in cosmetic formulations. Its siloxane framework contributes to its hydrophobic properties, allowing it to repel water and resist moisture, which is advantageous in formulations requiring water resistance. Additionally, the presence of the propyl group enhances its compatibility with organic materials, broadening its utility in industrial and consumer products. The compound is generally considered to have low toxicity, but like many siloxanes, it should be handled with care to avoid environmental accumulation. Overall, 1,1,1,3,5,5,5-Heptamethyl-3-propyltrisiloxane is valued for its stability, versatility, and performance in various chemical applications.

Formula: C₁₀H₂₈O₂Si₃

InChI: InChI=1S/C10H28O2Si3/c1-9-10-15(8,11-13(2,3)4)12-14(5,6)7/h9-10H2,1-8H3

InChI key: InChIKey=PGRZLADNCDNGTC-UHFFFAOYSA-N

SMILES: O([Si](O[Si](C)(C)C)(CCC)C)[Si](C)(C)C

Synonyms:

• 1,1,1,3,5,5,5-Heptamethyl-3-propyltrisiloxane
• n-Propylheptamethyltrisiloxane
• 3-Propylheptamethyltrisiloxane
• Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-3-propyl-
• 3-Propyl-1,1,1,3,5,5,5-heptamethyltrisiloxane