CAS 29070-92-6
:Pachymic acid
Description:
Pachymic acid is a triterpenoid compound primarily derived from the medicinal fungus Poria cocos, commonly known as the poria mushroom. It is characterized by its molecular formula, which typically includes a complex arrangement of carbon, hydrogen, and oxygen atoms, reflecting its structure as a pentacyclic triterpene. Pachymic acid exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. The compound is often studied for its effects on immune modulation and its ability to enhance the efficacy of certain therapies. In terms of physical properties, pachymic acid is generally a white to off-white crystalline solid, and it is soluble in organic solvents but has limited solubility in water. Its unique structure and biological activities contribute to its significance in traditional medicine and modern therapeutic applications. As research continues, further insights into its mechanisms of action and potential health benefits are anticipated.
Formula:C33H52O5
InChI:InChI=1S/C33H52O5/c1-19(2)20(3)10-11-22(29(36)37)28-25(35)18-33(9)24-12-13-26-30(5,6)27(38-21(4)34)15-16-31(26,7)23(24)14-17-32(28,33)8/h19,22,25-28,35H,3,10-18H2,1-2,4-9H3,(H,36,37)/t22-,25-,26+,27+,28+,31-,32-,33+/m1/s1
InChI key:InChIKey=VDYCLYGKCGVBHN-DRCQUEPLSA-N
SMILES:C[C@]12[C@@](C)([C@@]([C@@H](CCC(C(C)C)=C)C(O)=O)([C@H](O)C1)[H])CCC3=C2CC[C@@]4([C@]3(C)CC[C@H](OC(C)=O)C4(C)C)[H]
Synonyms:- (3b,16a)-3-(Acetyloxy)-16-hydroxy-24-methylenelanost-8-en-21-oic acid
- (3beta,16alpha,20R)-3-(acetyloxy)-16-hydroxy-24-methylidenelanost-8-en-21-oic acid
- 3-(Acetyloxy)-16-Hydroxy-24-Methylidenelanost-8-En-21-Oic Acid
- 3-O-Acetyltumulosic acid
- Eburica-8,24(28)-dien-21-oic acid, 3β,16α-dihydroxy-, 3-acetate
- Lanost-8-en-21-oic acid, 3-(acetyloxy)-16-hydroxy-24-methylene-, (3β,16α)-
- Lanost-8-en-21-oic acid, 3β,16α-dihydroxy-24-methylene-, 3-acetate
- NSC 244427
- Pachymic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
(3β,16α)-3-(Acetyloxy)-16-hydroxy-24-methylenelanost-8-en-21-oic acid
CAS:Formula:C33H52O5Purity:99%Color and Shape:SolidMolecular weight:528.7630Pachymic acid
CAS:Pachymic acid (PA) is a natural triterpenoid known to inhibit the phospholipase A2 (PLA(2)) family of arachidonic acid (AA)-producing enzymes, PA-treatment decreases bad phosphorylation, increases Bcl-2 phosphorylation, and activates caspases-9 and -3, it also decreases the expression and activation of proteins within the AKT signal pathway. suggests that PA initiates apoptosis through mitochondria dysfunction and influences apoptosis by reducing prostaglandin .Formula:C33H52O5Purity:95%~99%Color and Shape:PowderMolecular weight:528.774Pachymic acid
CAS:Pachymic acid (3-O-Acetyltumulosic acid) is a natural product, and inhibits Akt and ERK signaling pathways.Formula:C33H52O5Purity:99.39% - >99.99%Color and Shape:White PowderMolecular weight:528.76Pachymic acid
CAS:Carboxylic acid with alcohol functionFormula:C33H52O5Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:528.78Pachymic Acid
CAS:Controlled ProductApplications Pachymic Acid is a natural triterpene extract which suppresses invasiveness of pancreatic cancer cells through the downregulation of MMP-7.
References Cheng, S. et al.: Int. J. Oncol., 42, 1869 (2013); Wang, P. et al.: J. Sep. Sci., 36, 3511 (2013);Formula:C33H52O5Color and Shape:NeatMolecular weight:528.76Pachymic acid
CAS:Controlled ProductPachymic acid is a naturally occurring triterpenoid acid, which is primarily extracted from the sclerotium of Poria cocos, a medicinal fungus widely used in traditional Chinese medicine. It exhibits a range of biological activities attributed to its unique molecular structure. The mode of action of pachymic acid involves the modulation of various signaling pathways, including anti-inflammatory, antioxidant, and apoptotic mechanisms. Additionally, it impacts immune cell regulation and exhibits potential in tumor suppression.Formula:C33H52O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:528.76 g/mol








