CAS 29070-92-6: Pachymic acid
Description:Pachymic acid is a triterpenoid compound primarily derived from the medicinal fungus Poria cocos, commonly known as the poria mushroom. It is characterized by its molecular formula, which typically includes a complex arrangement of carbon, hydrogen, and oxygen atoms, reflecting its structure as a pentacyclic triterpene. Pachymic acid exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. The compound is often studied for its effects on immune modulation and its ability to enhance the efficacy of certain therapies. In terms of physical properties, pachymic acid is generally a white to off-white crystalline solid, and it is soluble in organic solvents but has limited solubility in water. Its unique structure and biological activities contribute to its significance in traditional medicine and modern therapeutic applications. As research continues, further insights into its mechanisms of action and potential health benefits are anticipated.
Formula:C33H52O5
InChI:InChI=1S/C33H52O5/c1-19(2)20(3)10-11-22(29(36)37)28-25(35)18-33(9)24-12-13-26-30(5,6)27(38-21(4)34)15-16-31(26,7)23(24)14-17-32(28,33)8/h19,22,25-28,35H,3,10-18H2,1-2,4-9H3,(H,36,37)/t22-,25-,26+,27+,28+,31-,32-,33+/m1/s1
InChI key:InChIKey=VDYCLYGKCGVBHN-DRCQUEPLSA-N
SMILES:O=C(OC1CCC2(C3=C(CCC2C1(C)C)C4(C)CC(O)C(C(C(=O)O)CCC(=C)C(C)C)C4(C)CC3)C)C
- Synonyms:
- (3b,16a)-3-(Acetyloxy)-16-hydroxy-24-methylenelanost-8-en-21-oic acid
- (3beta,16alpha,20R)-3-(acetyloxy)-16-hydroxy-24-methylidenelanost-8-en-21-oic acid
- 3-(Acetyloxy)-16-Hydroxy-24-Methylidenelanost-8-En-21-Oic Acid
- 3-O-Acetyltumulosic acid
- Eburica-8,24(28)-dien-21-oic acid, 3β,16α-dihydroxy-, 3-acetate
- Lanost-8-en-21-oic acid, 3-(acetyloxy)-16-hydroxy-24-methylene-, (3β,16α)-
- Lanost-8-en-21-oic acid, 3β,16α-dihydroxy-24-methylene-, 3-acetate
- NSC 244427
- Pachymic acid
