CAS 2908-73-8
:4-Amino-2-methyl-5-pyrimidinemethanesulfonic acid
Description:
4-Amino-2-methyl-5-pyrimidinemethanesulfonic acid, with the CAS number 2908-73-8, is an organic compound that features a pyrimidine ring substituted with an amino group and a methyl group, along with a methanesulfonic acid moiety. This compound is characterized by its polar nature due to the presence of the sulfonic acid group, which enhances its solubility in water. It typically appears as a crystalline solid and is often used in biochemical research, particularly in studies involving nucleic acids and enzyme activity. The amino group contributes to its basicity, while the sulfonic acid group imparts acidic properties, making it a zwitterionic compound under certain pH conditions. Its structural features allow it to participate in various chemical reactions, including those involving nucleophilic substitutions. Additionally, it may serve as a building block in the synthesis of more complex molecules in pharmaceutical and agrochemical applications. Overall, its unique properties make it a valuable compound in both research and industrial contexts.
Formula:C6H9N3O3S
InChI:InChI=1S/C6H9N3O3S/c1-4-8-2-5(6(7)9-4)3-13(10,11)12/h2H,3H2,1H3,(H2,7,8,9)(H,10,11,12)
InChI key:InChIKey=BONBSNIMLNTEIY-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)C=1C(N)=NC(C)=NC1
Synonyms:- (4-Amino-2-methyl-5-pyrimidyl)methanesulfonic acid
- (4-Amino-2-methylpyrimidin-1-ium-5-yl)methanesulfonate
- 2-Methyl-4-amino-5-sulfomethylpyrimidine
- 4-Amino-2-methyl-5-pyrimidinemethanesulfonic acid
- 5-Pyrimidinemethanesulfonic acid, 4-amino-2-methyl-
- NSC 165509
- Pyrimidinium, 4-Amino-2-Methyl-5-(Sulfomethyl)-, Inner Salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(4-Amino-2-methylpyrimidin-5-yl)methanesulfonic acid
CAS:Formula:C6H9N3O3SColor and Shape:SolidMolecular weight:203.2194-Amino-2-methyl-5-pyrimidinemethanesulfonic acid
CAS:Controlled ProductApplications 4-Amino-2-methyl-5-pyrimidinemethanesulfonic acid is used in the biosynthesis of Thiamine (T344185) in yeast.
References White, R., et al.: Journal of the American Chemical Society, 104, 4934 (1982).Formula:C6H9N3O3SColor and Shape:NeatMolecular weight:203.22

