CAS 290819-68-0
:[(3S,4R,5S,6S)-5-acetamido-4-benzoyloxy-6-benzyloxy-3-fluoro-tetrahydropyran-2-yl]methyl benzoate
Description:
The chemical substance with the name "[(3S,4R,5S,6S)-5-acetamido-4-benzoyloxy-6-benzyloxy-3-fluoro-tetrahydropyran-2-yl]methyl benzoate" and CAS number "290819-68-0" is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and is substituted with various functional groups including an acetamido group, benzoyloxy groups, and a benzyloxy group. The presence of a fluorine atom indicates potential reactivity and influences the compound's physical and chemical properties, such as polarity and solubility. The acetamido and benzoate moieties suggest potential applications in medicinal chemistry, possibly as intermediates in drug synthesis or as bioactive compounds. The stereochemical configuration (3S, 4R, 5S, 6S) is crucial for determining the compound's biological activity and interactions with biological targets. Overall, this compound exemplifies the complexity and diversity of organic molecules used in pharmaceutical research and development.
Formula:C29H28FNO7
InChI:InChI=1/C29H28FNO7/c1-19(32)31-25-26(38-28(34)22-15-9-4-10-16-22)24(30)23(18-35-27(33)21-13-7-3-8-14-21)37-29(25)36-17-20-11-5-2-6-12-20/h2-16,23-26,29H,17-18H2,1H3,(H,31,32)/t23?,24-,25+,26+,29+/m1/s1
Synonyms:- α-D-Glucopyranoside, phenylmethyl 2-(acetylamino)-2,4-dideoxy-4-fluoro-, 3,6-dibenzoate
- PhenylMethyl 2-(AcetylaMino)-2,4-dideoxy-4-fluoro-α-D-glucopyranoside 3,6-Dibenzoate
- Benzyl 2-Acetamido-3,6-di-O-benzoyl-2,4-dideoxy-4-fluoro-α-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Glucopyranoside, phenylmethyl 2-(acetylamino)-2,4-dideoxy-4-fluoro-, 3,6-dibenzoate
CAS:Formula:C29H28FNO7Color and Shape:SolidMolecular weight:521.5335Benzyl 2-acetamido-3,6-di-O-benzoyl-2,4-dideoxy-4-fluoro-α-D-glucopyranose
CAS:Molecular weight:521.53Benzyl 2-acetamido-3,6-di-O-benzoyl-2,4-dideoxy-4-fluoro-a-D-glucopyranoside
CAS:Benzyl 2-acetamido-3,6-di-O-benzoyl-2,4-dideoxy-4-fluoro-a-D-glucopyranoside is an oligosaccharide that possesses a complex sugar structure. It is custom synthesized in our laboratory and can be fluorinated, methylated, or modified with click chemistry. The compound is stable in water and has a high purity level.Formula:C29H28FNO7Purity:Min. 95%Molecular weight:521.53 g/mol


