CAS 290819-73-7
:N-[(2S,3S,4R,5S)-2-benzyloxy-5-fluoro-4-hydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide
Description:
N-[(2S,3S,4R,5S)-2-benzyloxy-5-fluoro-4-hydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide, with CAS number 290819-73-7, is a chemical compound characterized by its complex structure, which includes a tetrahydropyran ring and various functional groups such as a benzyloxy group, a fluoro substituent, and an acetamide moiety. This compound exhibits chirality, as indicated by its stereochemical descriptors (2S, 3S, 4R, 5S), which suggest specific spatial arrangements of its atoms that can influence its biological activity and interactions. The presence of hydroxyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity. Additionally, the fluoro group can impart unique electronic properties, potentially affecting the compound's pharmacological profile. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of antiviral or antibacterial agents. Overall, the structural features of this compound suggest a complex interplay of properties that could be explored for various chemical and biological applications.
Formula:C15H20FNO5
InChI:InChI=1/C15H20FNO5/c1-9(19)17-13-14(20)12(16)11(7-18)22-15(13)21-8-10-5-3-2-4-6-10/h2-6,11-15,18,20H,7-8H2,1H3,(H,17,19)/t11?,12-,13+,14+,15+/m1/s1
Synonyms:- PhenylMethyl 2-(AcetylaMino)-2,4-dideoxy-4-fluoro-α-D-glucopyranoside
- Benzyl 2-Acetamido-2,4-dideoxy-4-fluoro-α-D-glucopyranose
- Benzyl2-acetamido-3,6-di-O-benzoyl-2,4-dideoxy-4-fluoro-a-D-glucopyranoside
- α-D-Glucopyranoside, phenylmethyl 2-(acetylamino)-2,4-dideoxy-4-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Glucopyranoside, phenylmethyl 2-(acetylamino)-2,4-dideoxy-4-fluoro-
CAS:Formula:C15H20FNO5Color and Shape:SolidMolecular weight:313.3214Benzyl 2-acetamido-2,4-dideoxy-4-fluoro-a-D-glucopyranose
CAS:This high-purity custom synthesis is a sugar that is modified with Click chemistry. It is fluorinated, glycosylated, and has been synthesized using methylation and polysaccharide modification. In addition to being an oligosaccharide and monosaccharide, this carbohydrate is also a complex carbohydrate.Formula:C15H20FNO5Purity:Min. 95%Molecular weight:313.32 g/mol


