CAS 29082-91-5
:4-methoxypyridine-2-carboxylic acid
Description:
4-Methoxypyridine-2-carboxylic acid, with the CAS number 29082-91-5, is an organic compound characterized by its pyridine ring structure substituted with a methoxy group and a carboxylic acid functional group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. It exhibits acidic properties, as indicated by the carboxylic acid moiety, and can participate in various chemical reactions, including esterification and amidation. The methoxy group contributes to its overall polarity and can influence its reactivity and interaction with other molecules. 4-Methoxypyridine-2-carboxylic acid is of interest in pharmaceutical and agrochemical research, potentially serving as a building block for the synthesis of more complex compounds. Its unique structural features may also impart specific biological activities, making it a subject of study in medicinal chemistry.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c1-11-5-2-3-8-6(4-5)7(9)10/h2-4H,1H3,(H,9,10)
SMILES:COc1ccnc(c1)C(=O)O
Synonyms:- 2-Pyridinecarboxylic Acid, 4-Methoxy-
- 4-Methoxypyridine-2-Carboxylate
- 4-Methoxypyridine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Pyridinecarboxylic acid, 4-methoxy-
CAS:Formula:C7H7NO3Purity:98%Color and Shape:SolidMolecular weight:153.13544-Methoxypyridine-2-carboxylic acid
CAS:4-Methoxypyridine-2-carboxylic acidFormula:C7H7NO3Purity:98%Color and Shape: off-white powderMolecular weight:153.14g/mol4-Methoxy-2-pyridinecarboxylic Acid
CAS:Controlled ProductApplications 4-Methoxy-2-pyridinecarboxylic Acid is an intermediate to prepare diacid analogs as glycogen phosphorylase inhibitors. It is also used to prepare allyl phenylethyl ether via ruthenium-pyridinecarboxylic acid-catalyzed allylation.
References Lu, Z., et al.: Bioorg. Med. Chem. Lett., 13, 4125 (2003); Tanaka, S., et al.: Chem. Lett., 38, 188 (2009)Formula:C7H7NO3Color and Shape:NeatMolecular weight:153.14



