CAS 29082-92-6

5-Methoxypicolinic acid

Description:

5-Methoxypicolinic acid is an aromatic carboxylic acid characterized by its methoxy group (-OCH3) attached to the pyridine ring at the 5-position. This compound features a pyridine backbone, which contributes to its unique chemical properties, including its ability to participate in various chemical reactions such as esterification and amidation. It is typically a white to off-white solid and is soluble in polar solvents like water and alcohols, which enhances its utility in various applications. The presence of the methoxy group can influence its reactivity and biological activity, making it of interest in medicinal chemistry and material science. Additionally, 5-Methoxypicolinic acid may exhibit biological properties, including potential antimicrobial or anti-inflammatory effects, although specific biological activities can vary based on structural modifications and environmental conditions. Its CAS number, 29082-92-6, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks. Overall, 5-Methoxypicolinic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₇H₇NO₃

InChI: InChI=1S/C7H7NO3/c1-11-5-2-3-6(7(9)10)8-4-5/h2-4H,1H3,(H,9,10)

InChI key: InChIKey=YPKUGKJFOOZLHN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=C(OC)C=N1

Synonyms:

• 2-Pyridinecarboxylic acid, 5-methoxy-
• 5-Methoxy-2-pyridinecarboxylic acid
• 5-Methoxypicolinic acid
• 5-Methoxypyridine-2-Carboxylic Acid
• Picolinic acid, 5-methoxy-

5-Methoxypicolinic acid

CAS: 29082-92-6

Formula: C₇H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA002XA5

5-Methoxypicolinic acid

CAS: 29082-92-6

5-Methoxypicolinic acid

Purity: 97%

Molecular weight: 153.14g/mol

Ref: 54-OR907539

5-Methoxypyridine-2-carboxylic acid

CAS: 29082-92-6

Formula: C₇H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.137

Ref: 10-F044877