CymitQuimica logo

CAS 29097-00-5

:

methyl 5-amino-1H-pyrazole-4-carboxylate

Description:
Methyl 5-amino-1H-pyrazole-4-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amino group (-NH2) and a carboxylate group (-COOCH3) attached to the pyrazole ring, contributing to its reactivity and potential applications in medicinal chemistry. It is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, which enhances its utility in various chemical reactions. The presence of the amino group allows for further derivatization, making it a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which is of interest in drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, methyl 5-amino-1H-pyrazole-4-carboxylate is a significant compound in organic synthesis and medicinal chemistry.
Formula:C5H7N3O2
InChI:InChI=1/C5H7N3O2/c1-10-5(9)3-2-7-8-4(3)6/h2H,1H3,(H3,6,7,8)
InChI key:KGQFAPZUQKYADG-UHFFFAOYSA-N
SMILES:COC(=O)c1c[nH][nH]c1=N
Synonyms:
  • 1H-pyrazole-4-carboxylic acid, 3-amino-, methyl ester
  • 1H-pyrazole-4-carboxylic acid, 5-amino-, methyl ester
Found 4 products.