CAS 29097-52-7
:2,2,4,4-tetramethyl-3-pentanone imine
Description:
2,2,4,4-Tetramethyl-3-pentanone imine is an organic compound characterized by its imine functional group, which is formed by the condensation of an amine and a carbonyl compound. This compound features a branched structure with multiple methyl groups, contributing to its steric hindrance and potentially influencing its reactivity and physical properties. Typically, imines exhibit properties such as being polar, which can affect their solubility in various solvents. The presence of the bulky tetramethyl groups may also impart unique characteristics, such as increased stability and lower volatility compared to simpler imines. In terms of applications, compounds like 2,2,4,4-tetramethyl-3-pentanone imine may be utilized in organic synthesis, particularly in the formation of more complex molecules or as intermediates in various chemical reactions. Safety data should be consulted for handling and storage, as imines can vary in toxicity and reactivity. Overall, this compound exemplifies the diverse chemistry of imines and their potential utility in synthetic organic chemistry.
Formula:C9H19N
InChI:InChI=1/C9H19N/c1-8(2,3)7(10)9(4,5)6/h10H,1-6H3
SMILES:CC(C)(C)C(=N)C(C)(C)C
Synonyms:- 2,2,4,4-Tetramethylpentan-3-Imine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2,4,4-Tetramethyl-3-pentanone Imine
CAS:Formula:C9H19NPurity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:141.263-Pentanimine, 2,2,4,4-tetramethyl-
CAS:Formula:C9H19NPurity:96%Color and Shape:LiquidMolecular weight:141.25392,2,4,4-Tetramethyl-3-pentanone imine
CAS:<p>2,2,4,4-Tetramethyl-3-pentanone imine</p>Purity:95%Molecular weight:141.25g/mol2,2,4,4-Tetramethyl-3-pentanone imine
CAS:<p>2,2,4,4-Tetramethyl-3-pentanone imine is a catalytic reagent that is used in organic synthesis. It hydrolyses tert-butyl chloride to produce tert-butanol and hydrogen chloride gas. 2,2,4,4-Tetramethyl-3-pentanone imine can be used for the oxidation of chlorides to produce chlorocarbons or for the conversion of ketones to pivalonitrile. This compound has also been shown to be capable of oxidizing dienes and pivalonitrile at low temperatures.</p>Formula:C9H19NPurity:Min. 95%Molecular weight:141.26 g/mol




