CymitQuimica logo

CAS 29098-72-4

:

4-(2-pyridyl)-2-(trimethoxysilylmethyl)butane-1-thiol

Description:
4-(2-Pyridyl)-2-(trimethoxysilylmethyl)butane-1-thiol, with the CAS number 29098-72-4, is an organosilicon compound characterized by the presence of both a thiol group and a trimethoxysilyl moiety. This compound features a pyridine ring, which contributes to its potential as a ligand in coordination chemistry and catalysis. The trimethoxysilyl group enhances its compatibility with silicate surfaces, making it useful in applications such as surface modification and adhesion promotion in various materials, including polymers and glass. The thiol group provides reactivity, allowing for the formation of disulfide bonds and facilitating interactions with metals and other substrates. Additionally, the presence of the butane chain adds to its hydrophobic characteristics, influencing solubility and interaction with organic materials. Overall, this compound's unique structure imparts multifunctional properties, making it valuable in fields such as materials science, nanotechnology, and surface chemistry.
Formula:C13H23NO3SSi
InChI:InChI=1/C13H23NO3SSi/c1-15-19(16-2,17-3)11-12(10-18)7-8-13-6-4-5-9-14-13/h4-6,9,12,18H,7-8,10-11H2,1-3H3
SMILES:CO[Si](CC(CCc1ccccn1)CS)(OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.