CAS 29102-47-4
:2-(aziridin-1-yl)-3-(2-chloroethyl)-1,3,2-oxazaphosphinane 2-oxide
Description:
2-(Aziridin-1-yl)-3-(2-chloroethyl)-1,3,2-oxazaphosphinane 2-oxide is a chemical compound characterized by its unique structure, which includes a phosphinane ring, an aziridine moiety, and a chloroethyl group. This compound belongs to a class of organophosphorus compounds, which are known for their diverse applications in medicinal chemistry and as potential pharmaceuticals. The presence of the aziridine ring suggests potential reactivity, particularly in cycloaddition reactions, while the chloroethyl group may impart biological activity or facilitate interactions with biological targets. The oxazaphosphinane structure contributes to its stability and may influence its solubility and reactivity. Additionally, the compound's phosphorus-oxygen bond indicates potential for coordination with metal ions or participation in further chemical transformations. Overall, this compound's unique combination of functional groups and structural features makes it of interest for further research in synthetic chemistry and potential therapeutic applications.
Formula:C7H14ClN2O2P
InChI:InChI=1/C7H14ClN2O2P/c8-2-4-9-3-1-7-12-13(9,11)10-5-6-10/h1-7H2
SMILES:C1CN(CCCl)P(=O)(N2CC2)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyleniminoifosfamide
CAS:Controlled ProductFormula:C7H14ClN2O2PColor and Shape:NeatMolecular weight:224.63
