CAS 29106-51-2: Procyanidin B4
Description:Procyanidin B4, with the CAS number 29106-51-2, is a type of flavonoid compound belonging to the proanthocyanidin class. It is a dimeric flavanol, primarily composed of two units of catechin or epicatechin linked by a carbon-carbon bond. This compound is commonly found in various plants, particularly in fruits, seeds, and bark, contributing to the astringency and color of these materials. Procyanidin B4 exhibits antioxidant properties, which can help neutralize free radicals and may contribute to various health benefits, including cardiovascular protection and anti-inflammatory effects. Additionally, it has been studied for its potential role in promoting metabolic health and reducing the risk of chronic diseases. The compound is soluble in organic solvents and has limited solubility in water, which influences its bioavailability and absorption in biological systems. Overall, Procyanidin B4 is of significant interest in both nutritional science and pharmacology due to its potential health-promoting properties.
Formula:C30H26O12
InChI:InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28-,29-/m1/s1
InChI key:InChIKey=XFZJEEAOWLFHDH-VUGKQVTMSA-N
SMILES:OC=1C=C(O)C2=C(OC(C3=CC=C(O)C(O)=C3)C(O)C2C=4C(O)=CC(O)=C5C4OC(C6=CC=C(O)C(O)=C6)C(O)C5)C1
- Synonyms:
- [4,8′-Bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol, 2,2′-bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-, [2R-[2α,3β,4α(2′R*,3′R*)]]-
- [4,8′′-Biflavan]-3,3′,3′′,3′′′,4′,4′′′,5,5′′,7,7′′-decol, stereoisomer
- Procyanidin B4
- [4,8′-Bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol, 2,2′-bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-, (2R,2′R,3S,3′R,4S)-
- (2R,2′R,3S,3′R,4S)-2,2′-Bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro[4,8′-bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol
