CAS 29106-51-2
:Procyanidin B4
Description:
Procyanidin B4, with the CAS number 29106-51-2, is a type of flavonoid compound belonging to the proanthocyanidin class. It is a dimeric flavanol, primarily composed of two units of catechin or epicatechin linked by a carbon-carbon bond. This compound is commonly found in various plants, particularly in fruits, seeds, and bark, contributing to the astringency and color of these materials. Procyanidin B4 exhibits antioxidant properties, which can help neutralize free radicals and may contribute to various health benefits, including cardiovascular protection and anti-inflammatory effects. Additionally, it has been studied for its potential role in promoting metabolic health and reducing the risk of chronic diseases. The compound is soluble in organic solvents and has limited solubility in water, which influences its bioavailability and absorption in biological systems. Overall, Procyanidin B4 is of significant interest in both nutritional science and pharmacology due to its potential health-promoting properties.
Formula:C30H26O12
InChI:InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28-,29-/m1/s1
InChI key:InChIKey=XFZJEEAOWLFHDH-VUGKQVTMSA-N
SMILES:O[C@H]1[C@@H](C=2C(O[C@@H]1C3=CC(O)=C(O)C=C3)=CC(O)=CC2O)C4=C5C(C[C@@H](O)[C@H](O5)C6=CC(O)=C(O)C=C6)=C(O)C=C4O
Synonyms:- [4,8′-Bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol, 2,2′-bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-, [2R-[2α,3β,4α(2′R*,3′R*)]]-
- [4,8′′-Biflavan]-3,3′,3′′,3′′′,4′,4′′′,5,5′′,7,7′′-decol, stereoisomer
- Procyanidin B4
- [4,8′-Bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol, 2,2′-bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-, (2R,2′R,3S,3′R,4S)-
- (2R,2′R,3S,3′R,4S)-2,2′-Bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro[4,8′-bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Procyanidol B4
CAS:Procyanidin B4 reveals significant antioxidant activityFormula:C30H26O12Purity:98%Color and Shape:SolidMolecular weight:578.52Procyanidin B4
CAS:Applications Procyanidin B4 (CAS# 29106-51-2) is a useful research chemical compound.
Formula:C30H26O12Color and Shape:NeatMolecular weight:578.52Procyanidin B4
CAS:Procyanidin B4 is a type of proanthocyanidin, which is a class of flavonoids. This compound is predominantly derived from various plant sources, notably grape seeds and certain fruits like apples. Its mode of action is primarily through its antioxidant properties, which involve scavenging free radicals and reducing oxidative stress at the cellular level. Procyanidin B4 operates by stabilizing free radicals with its phenolic hydroxyl groups, thereby inhibiting lipid peroxidation and protecting cellular components such as DNA, proteins, and lipids from oxidative damage.
Formula:C30H26O12Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:578.52 g/molRef: 3D-XP181118
Discontinued product





