CAS 2911-90-2
:3-hydroxyestra-1,3,5(10),8-tetraen-17-one
Description:
3-Hydroxyestra-1,3,5(10),8-tetraen-17-one, commonly referred to as estradiol, is a steroid hormone that plays a crucial role in the regulation of the female reproductive system and secondary sexual characteristics. It is characterized by its polycyclic structure, which includes a phenolic hydroxyl group at the C3 position and a ketone at the C17 position. This compound exhibits significant biological activity, primarily as an estrogen, influencing various physiological processes such as menstrual cycle regulation, bone density maintenance, and cardiovascular health. Its chemical formula reflects a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its lipophilic nature, which allows it to easily cross cell membranes and bind to estrogen receptors. The compound is synthesized in the ovaries, adrenal glands, and placenta, and its levels fluctuate throughout the menstrual cycle. Due to its potent effects, it is also utilized in various therapeutic applications, including hormone replacement therapy and contraceptive formulations. Understanding its properties is essential for both clinical and pharmacological contexts.
Formula:C18H20O2
InChI:InChI=1/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,16,19H,2,4,6-9H2,1H3/t16-,18-/m0/s1
SMILES:C[C@]12CCC3=C(CCc4cc(ccc34)O)[C@@H]1CCC2=O
Synonyms:- Estra-1,3,5(10),8-tetraen-17-one, 3-hydroxy-, (+-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
