CAS 2912-98-3
:N-hydroxy-1-phenylethanamine
Description:
N-hydroxy-1-phenylethanamine, also known as N-hydroxyphenethylamine, is an organic compound characterized by the presence of a hydroxyl group (-OH) attached to the nitrogen atom of a phenethylamine structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and organic solvents, which makes it versatile for various applications. The presence of the hydroxyl group enhances its reactivity, allowing it to participate in various chemical reactions, including those involving oxidation and conjugation. N-hydroxy-1-phenylethanamine is often studied in the context of medicinal chemistry and biochemistry due to its potential role as a precursor in the synthesis of other biologically active compounds. Additionally, it may exhibit biological activities, including effects on neurotransmitter systems, although specific pharmacological properties can vary. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H11NO
InChI:InChI=1/C8H11NO/c1-7(9-10)8-5-3-2-4-6-8/h2-7,9-10H,1H3
SMILES:CC(c1ccccc1)NO
Synonyms:- [1-(Hydroxyamino)ethyl]benzol
- benzenemethanamine, N-hydroxy-α-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-(1-Phenylethyl)hydroxylamine
CAS:N-(1-Phenylethyl)hydroxylamine is a research chemical that belongs to the class of oximes. It has been shown to react with a variety of amines and lipoxygenase in the presence of p-toluenesulfonic acid to form an N-hydroxyamino derivative. This reaction is stereospecific and enantioselective, which means it will only take place when the chiral center is on one side of the molecule. The hydroxylamine group is also synthesized by a novel asymmetric synthesis method involving ketones. This synthetic process uses tert-butyl and primary amines, which are racemized during the reaction.
Formula:C8H11NOPurity:Min. 95%Molecular weight:137.18 g/mol
