CAS 29124-54-7
:5-Chloro-2-(methylsulfonyl)benzenamine
Description:
5-Chloro-2-(methylsulfonyl)benzenamine, with the CAS number 29124-54-7, is an organic compound characterized by the presence of a chloro group and a methylsulfonyl group attached to a benzene ring. This compound features an amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The chloro substituent typically enhances the compound's electrophilic properties, making it useful in nucleophilic substitution reactions. The methylsulfonyl group, known for its ability to act as a leaving group, can also influence the compound's solubility and polarity. In terms of physical properties, compounds of this nature are often solid at room temperature and may exhibit moderate to high solubility in polar solvents due to the presence of the sulfonyl group. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its functional groups that can participate in further chemical transformations. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C7H8ClNO2S
InChI:InChI=1S/C7H8ClNO2S/c1-12(10,11)7-3-2-5(8)4-6(7)9/h2-4H,9H2,1H3
InChI key:InChIKey=GZPZIEPSQSEDLT-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(N)C=C(Cl)C=C1
Synonyms:- 5-Chloro-2-(methylsulfonyl)benzenamine
- Aniline, 5-chloro-2-(methylsulfonyl)-
- Benzenamine, 5-Chloro-2-(Methylsulfonyl)-
- 5-Chloro-2-(methylsulfonyl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
