CAS 29124-56-9

2'-Amino-5'-bromoacetophenone

Description:

2'-Amino-5'-bromoacetophenone, with the CAS number 29124-56-9, is an organic compound characterized by the presence of an amino group and a bromo substituent on a phenyl ring that is also attached to an acetophenone moiety. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic structure. The amino group (-NH2) contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The bromo group (-Br) serves as a useful site for further functionalization, allowing for the introduction of additional substituents through halogen exchange reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), can vary based on purity and specific conditions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₈H₈BrNO

InChI: InChI=1/C8H8BrNO/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,10H2,1H3

SMILES: CC(=O)c1cc(ccc1N)Br

Synonyms:

• 1-(2-Amino-5-bromophenyl)ethanone

Ethanone, 1-(2-amino-5-bromophenyl)-

CAS: 29124-56-9

Formula: C₈H₈BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 214.0592

Ref: IN-DA002XES

1-(2-Amino-5-bromophenyl)ethanone

CAS: 29124-56-9

1-(2-Amino-5-bromophenyl)ethanone

Purity: 97%

Molecular weight: 214.06g/mol

Ref: 54-OR73161

1-(2-Amino-5-bromophenyl)ethanone

CAS: 29124-56-9

Formula: C₈H₈BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 214.062

Ref: 10-F077115