CAS 29125-80-2: Quercetin 3,4′-diglucoside
Description:Quercetin 3,4′-diglucoside, also known as quercetrin, is a flavonoid glycoside characterized by its structure, which consists of a quercetin molecule bound to two glucose units. This compound is commonly found in various plants, particularly in fruits, vegetables, and herbs, contributing to their antioxidant properties. Quercetin 3,4′-diglucoside exhibits several biological activities, including anti-inflammatory, antiviral, and anticancer effects, making it of interest in nutritional and pharmaceutical research. It is soluble in water and exhibits a yellow color, typical of flavonoids. The compound is often studied for its potential health benefits, including its role in reducing oxidative stress and modulating immune responses. Its CAS number, 29125-80-2, is used for identification in chemical databases and regulatory contexts. Overall, quercetin 3,4′-diglucoside is a significant compound in the field of natural products and health sciences, highlighting the importance of flavonoids in human health and nutrition.
Formula:C27H30O17
InChI:InChI=1S/C27H30O17/c28-6-14-17(33)20(36)22(38)26(42-14)41-12-2-1-8(3-10(12)31)24-25(19(35)16-11(32)4-9(30)5-13(16)40-24)44-27-23(39)21(37)18(34)15(7-29)43-27/h1-5,14-15,17-18,20-23,26-34,36-39H,6-7H2/t14-,15-,17-,18-,20+,21+,22-,23-,26-,27+/m1/s1
InChI key:InChIKey=RPVIQWDFJPYNJM-DEFKTLOSSA-N
SMILES:O=C1C(OC2OC(CO)C(O)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=CC(OC5OC(CO)C(O)C(O)C5O)=C(O)C4
- Synonyms:
- Quercetin 3,4′-O-β-diglucopyranoside
- Quercetin 3,4′-diglucoside
- Flavone, 3,3′,4′,5,7-pentahydroxy-, 3,4′-di-β-D-glucopyranoside
- 3-(β-D-Glucopyranosyloxy)-2-[4-(β-D-glucopyranosyloxy)-3-hydroxyphenyl]-5,7-dihydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-(β-D-glucopyranosyloxy)-2-[4-(β-D-glucopyranosyloxy)-3-hydroxyphenyl]-5,7-dihydroxy-
