CAS 29140-72-5
:3-methyl-4-pentylpiperazine-1-carbodithioic acid
Description:
3-Methyl-4-pentylpiperazine-1-carbodithioic acid, with the CAS number 29140-72-5, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. The presence of a methyl group and a pentyl chain contributes to its unique properties, influencing its solubility and reactivity. The carbodithioic acid functional group indicates that the compound contains both a carbonyl and a dithiocarboxylic acid moiety, which can impart specific chemical reactivity, particularly in nucleophilic addition reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. As with many organic compounds, safety data and handling precautions should be considered, as the presence of sulfur and nitrogen can affect toxicity and environmental impact.
Formula:C11H22N2S2
InChI:InChI=1/C11H22N2S2/c1-3-4-5-6-12-7-8-13(11(14)15)9-10(12)2/h10H,3-9H2,1-2H3,(H,14,15)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
