CAS 2915-16-4

2-chloro-4,6-diphenylpyrimidine

Description:

2-Chloro-4,6-diphenylpyrimidine is an organic compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The presence of two phenyl groups at positions 4 and 6 contributes to its aromatic character and influences its chemical reactivity and solubility. The chlorine substituent at position 2 enhances its electrophilic properties, making it a potential candidate for various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the field of medicinal chemistry. The compound's structure allows for various modifications, which can lead to derivatives with altered pharmacological properties. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, 2-chloro-4,6-diphenylpyrimidine is a significant compound in synthetic organic chemistry and drug discovery.

Formula: C₁₆H₁₁ClN₂

InChI: InChI=1/C16H11ClN2/c17-16-18-14(12-7-3-1-4-8-12)11-15(19-16)13-9-5-2-6-10-13/h1-11H

SMILES: c1ccc(cc1)c1cc(c2ccccc2)nc(Cl)n1

Synonyms:

• 2-chloro-4,6-diphenyl-Pyrimidine

Pyrimidine, 2-chloro-4,6-diphenyl-

CAS: 2915-16-4

Formula: C₁₆H₁₁ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 266.7249

Ref: IN-DA002XHO

2-Chloro-4,6-diphenylpyrimidine

CAS: 2915-16-4

2-Chloro-4,6-diphenylpyrimidine

Purity: 98%

Molecular weight: 266.72g/mol

Ref: 54-OR96042

2-Chloro-4,6-diphenylpyrimidine

CAS: 2915-16-4

Formula: C₁₆H₁₁ClN₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 266.73

Ref: 3B-C3123

2-Chloro-4,6-diphenylpyrimidine

CAS: 2915-16-4

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 266.7300109863281

Ref: 10-F239907