CAS 291545-04-5
:(αS)-N-(2-Bromophenyl)-α-methylbenzenemethanamine
Description:
(αS)-N-(2-Bromophenyl)-α-methylbenzenemethanamine, identified by its CAS number 291545-04-5, is a chemical compound that belongs to the class of substituted phenylamines. This substance features a chiral center, indicated by the (αS) designation, which suggests that it can exist in enantiomeric forms. The presence of a bromine atom in the 2-position of the phenyl ring contributes to its reactivity and potential biological activity. The α-methyl group enhances steric hindrance, which can influence the compound's interaction with biological targets, potentially affecting its pharmacological properties. This compound may exhibit properties typical of amines, such as basicity and the ability to form salts. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific data regarding its solubility, stability, and toxicity would require further investigation through experimental studies or literature review. Overall, this compound represents a unique structure that may be of interest in various chemical and biological research contexts.
Formula:C14H14BrN
InChI:InChI=1/C14H14BrN/c1-11(12-7-3-2-4-8-12)16-14-10-6-5-9-13(14)15/h2-11,16H,1H3
InChI key:InChIKey=LTRJAMPTYSTWNQ-NSHDSACASA-N
SMILES:N([C@@H](C)C1=CC=CC=C1)C2=C(Br)C=CC=C2
Synonyms:- (αS)-N-(2-Bromophenyl)-α-methylbenzenemethanamine
- 2-Bromo-N-(1-phenylethyl)aniline
- 2-Bromo-N-[(1S)-1-phenylethyl]aniline
- Benzenemethanamine, N-(2-bromophenyl)-α-methyl-, (αS)-
- benzenemethanamine, N-(2-bromophenyl)-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Bromo-N-[(1S)-1-phenylethyl]aniline hydrochloride
CAS:2-Bromo-N-[(1S)-1-phenylethyl]aniline hydrochloride
Molecular weight:312.63g/mol
