CymitQuimica logo

CAS 29159-23-7

:

Aminobenzaldehydepolymer

Description:
Aminobenzaldehyde polymer, identified by the CAS number 29159-23-7, is a synthetic polymer characterized by the presence of aminobenzaldehyde units in its structure. This polymer typically exhibits properties such as good thermal stability, chemical resistance, and mechanical strength, making it suitable for various applications in coatings, adhesives, and composites. The presence of amino and aldehyde functional groups allows for potential reactivity, enabling further modification or cross-linking with other materials. Additionally, aminobenzaldehyde polymers may display interesting optical properties, which can be advantageous in applications requiring light absorption or emission. The polymer's solubility can vary depending on its molecular weight and the specific formulation, influencing its processing and application methods. Overall, aminobenzaldehyde polymer is valued for its versatility and functional characteristics in industrial and research settings.
Formula:(C7H7NO)x
InChI:InChI=1/C7H7NO/c8-7-3-1-2-6(4-7)5-9/h1-5H,8H2
SMILES:c1cc(cc(c1)N)C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.