CAS 29162-73-0: 5,10,15,20-tetrakis(4-bromophenyl)porphyrin
Description:5,10,15,20-tetrakis(4-bromophenyl)porphyrin is a synthetic porphyrin compound characterized by its complex structure, which includes a porphyrin core with four 4-bromophenyl substituents. This compound exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in various applications such as photodynamic therapy, dye-sensitized solar cells, and as a probe in biochemical studies. The presence of bromine atoms enhances its electronic properties and solubility in organic solvents, while also influencing its reactivity and stability. The porphyrin ring system contributes to its ability to coordinate with metal ions, allowing for the formation of metal complexes that can exhibit unique catalytic and electronic properties. Additionally, the compound's planar structure and conjugated system provide significant π-π stacking interactions, which can affect its aggregation behavior in solution. Overall, 5,10,15,20-tetrakis(4-bromophenyl)porphyrin is a versatile compound with notable optical and electronic characteristics, making it a subject of interest in both materials science and medicinal chemistry.
Formula:C44H26Br4N4
InChI:InChI=1/C44H26Br4N4/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27/h1-24,49-50H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-