CAS 29162-73-0

5,10,15,20-tetrakis(4-bromophenyl)porphyrin

Description:

5,10,15,20-tetrakis(4-bromophenyl)porphyrin is a synthetic porphyrin compound characterized by its complex structure, which includes a porphyrin core with four 4-bromophenyl substituents. This compound exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in various applications such as photodynamic therapy, dye-sensitized solar cells, and as a probe in biochemical studies. The presence of bromine atoms enhances its electronic properties and solubility in organic solvents, while also influencing its reactivity and stability. The porphyrin ring system contributes to its ability to coordinate with metal ions, allowing for the formation of metal complexes that can exhibit unique catalytic and electronic properties. Additionally, the compound's planar structure and conjugated system provide significant π-π stacking interactions, which can affect its aggregation behavior in solution. Overall, 5,10,15,20-tetrakis(4-bromophenyl)porphyrin is a versatile compound with notable optical and electronic characteristics, making it a subject of interest in both materials science and medicinal chemistry.

Formula: C₄₄H₂₆Br₄N₄

InChI: InChI=1/C44H26Br4N4/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27/h1-24,49-50H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-

SMILES: c1cc(ccc1C1=c2ccc(=C(c3ccc(cc3)Br)C3=NC(=C(c4ccc(cc4)Br)C4=NC(=C(c5ccc(cc5)Br)c5ccc1[nH]5)C=C4)C=C3)[nH]2)Br

5,10,15,20-Tetrakis(4-bromophenyl)porphyrin

CAS: 29162-73-0

Formula: C₄₄H₂₆Br₄N₄

Purity: >95.0%(HPLC)

Color and Shape: Purple to Dark purple powder to crystal

Molecular weight: 930.34

Ref: 3B-T3467

Meso-tetra (p-bromophenyl) porphine

CAS: 29162-73-0

Formula: C₄₄H₂₆Br₄N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 930.3200

Ref: IN-DA00C1AR

Meso-Tetra (P-Bromophenyl) Porphine

CAS: 29162-73-0

Meso-Tetra (P-Bromophenyl) Porphine

Purity: 95%

Molecular weight: 930.32g/mol

Ref: 54-OR1013736

Tetra(p-bromophenyl)porphyrin

CAS: 29162-73-0

Tetra(p-bromophenyl)porphyrin (compound 5c), a fluorescent dye, is employed in synthesizing perfluoroalkyl-substituted tetrakisphenylporphyrins [1].

Formula: C₄₄H₂₆Br₄N₄

Color and Shape: Solid

Molecular weight: 930.32

Ref: TM-T78443

meso-Tetra (p-bromophenyl) porphine

CAS: 29162-73-0

Formula: C₄₄H₂₆Br₄N₄

Purity: >95%

Molecular weight: 930.32

Ref: FT-T40533

Tetra(p-bromophenyl)porphyrin

CAS: 29162-73-0

Purity: 98%

Color and Shape: Solid

Molecular weight: 930.3359985

Ref: 10-F615642

meso-Tetra (p-Bromophenyl) Porphine

Controlled Product

CAS: 29162-73-0

Applications meso-Tetra (p-Bromophenyl) Porphine is a synthetic halogenated porphyrin.

Formula: C₄₄H₂₆Br₄N₄

Color and Shape: Neat

Molecular weight: 930.32

Ref: TR-T310613

Tetrabromophenyl-porphyrin

CAS: 29162-73-0

Tetrabromophenyl-porphyrin (TBP) is a synthetic molecule that interacts with aldehydes in the presence of light. This interaction results in the formation of a phenyl radical and an excited state, which leads to the production of carbon dioxide and water. TBP is used as a catalyst for these reactions because it is more stable than other molecules that are typically used. The catalytic effect of TBP can be studied by means of spectroscopies and microscopy techniques. The crystal x-ray diffraction technique was used to analyze the molecular structure of TBP by determining the distances between atoms in its molecules. It was discovered that TBP has two phenyl groups and four bromine atoms per porphyrin ring. Diffraction techniques were also used to study how light interacts with TBP molecules, showing that they have strong optical properties when adsorbed on surfaces.

Formula: C₄₄H₂₆N₄Br₄

Purity: Min. 95%

Molecular weight: 930.32 g/mol

Ref: 3D-FT32237