CAS 29170-19-2

Carbamic acid, (2-aminoethyl)-, methyl ester, monohydrochloride

Description:

Carbamic acid, (2-aminoethyl)-, methyl ester, monohydrochloride, also known by its CAS number 29170-19-2, is a chemical compound that features a carbamic acid functional group combined with an aminoethyl moiety and a methyl ester. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of both an amino group and a carbamate structure suggests potential applications in pharmaceuticals, particularly as a building block in drug synthesis or as an intermediate in organic reactions. Its properties may include moderate stability under standard conditions, but it could be sensitive to hydrolysis, especially in the presence of strong acids or bases. Additionally, the compound's biological activity may be influenced by its ability to interact with various biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₄H₁₀N₂O₂·ClH

InChI: InChI=1S/C4H10N2O2.ClH/c1-8-4(7)6-3-2-5;/h2-3,5H2,1H3,(H,6,7);1H

InChI key: InChIKey=VKYMHVFPBRGFER-UHFFFAOYSA-N

SMILES: C(NCCN)(OC)=O.Cl

Synonyms:

• Carbamic acid, (2-aminoethyl)-, methyl ester, monohydrochloride

Methyl N-(2-aminoethyl)carbamate hydrochloride

CAS: 29170-19-2

Versatile small molecule scaffold

Formula: C₄H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 154.59 g/mol

Ref: 3D-EBA17019