
CAS 29173-31-7
:Mecarphon
Description:
Mecarphon, with the CAS number 29173-31-7, is a chemical compound primarily recognized for its application as an insecticide and acaricide in agricultural practices. It belongs to the class of organophosphates, which are known for their ability to inhibit acetylcholinesterase, an enzyme critical for the proper functioning of the nervous system in insects. Mecarphon is characterized by its relatively low toxicity to mammals compared to other organophosphates, making it a preferred choice in certain pest control scenarios. The compound is typically used in formulations that target a variety of pests, including aphids and spider mites, and is valued for its effectiveness in both contact and systemic applications. Its mode of action involves disrupting the normal transmission of nerve impulses, leading to paralysis and death in targeted pests. Additionally, Mecarphon's stability and solubility in various solvents enhance its utility in agricultural formulations. However, as with all pesticides, it is essential to follow safety guidelines and regulations to minimize environmental impact and ensure human safety during application.
Formula:C7H14NO4PS2
InChI:InChI=1S/C7H14NO4PS2/c1-8(7(10)11-2)6(9)5-15-13(4,14)12-3/h5H2,1-4H3
InChI key:InChIKey=PUTUPQVEMBRCAG-UHFFFAOYSA-N
SMILES:N(C(CSP(OC)(C)=S)=O)(C(OC)=O)C
Synonyms:- Mecarphon
- 7-Oxa-5-thia-2-aza-6-phosphaoctanoic acid, 2,6-dimethyl-3-oxo-, methyl ester, 6-sulfide
- 2-Oxa-4-thia-7-aza-3-phosphaoctan-8-oic acid, 3,7-dimethyl-6-oxo-, methyl ester, 3-sulfide
- Phosphonodithioic acid, methyl-, O-methyl ester, S-ester with methyl (mercaptoacetyl)methylcarbamate
- Carbamic acid, (mercaptoacetyl)methyl-, methyl ester, S-ester with O-methyl methylphosphonodithioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mercarphon
CAS:Mercarphon is a biochemical.Formula:C7H14NO4PS2Color and Shape:SolidMolecular weight:271.29
