
CAS 29176-29-2
:8-Chloro-1,3,4,5-tetrahydro-1-phenyl-2H-1,5-benzodiazepin-2-one
Description:
8-Chloro-1,3,4,5-tetrahydro-1-phenyl-2H-1,5-benzodiazepin-2-one is a chemical compound belonging to the benzodiazepine class, characterized by its fused benzene and diazepine rings. This compound features a chloro substituent at the 8-position and a phenyl group at the 1-position, contributing to its unique pharmacological properties. It typically exhibits a solid state at room temperature and is soluble in organic solvents, though its solubility in water is limited. The presence of the chloro group can influence its reactivity and biological activity, potentially affecting its interaction with neurotransmitter systems. As a benzodiazepine derivative, it may possess anxiolytic, sedative, or anticonvulsant properties, although specific biological activities would depend on further empirical studies. The compound's molecular structure allows for various potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting the central nervous system. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity and regulatory considerations.
Formula:C15H13ClN2O
InChI:InChI=1S/C15H13ClN2O/c16-11-6-7-13-14(10-11)18(15(19)8-9-17-13)12-4-2-1-3-5-12/h1-7,10,17H,8-9H2
InChI key:InChIKey=IUJQOUHDFKALCY-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(NCC1)=CC=C(Cl)C2)C3=CC=CC=C3
Synonyms:- 2H-1,5-Benzodiazepin-2-one, 8-chloro-1,3,4,5-tetrahydro-1-phenyl-
- 8-Chloro-1,3,4,5-tetrahydro-1-phenyl-2H-1,5-benzodiazepin-2-one
- Lofendazam
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lofendazam
CAS:Controlled ProductLofendazam is an antimicrobial agent that binds to the hydroxyl group on bacterial cell surfaces. It is used in cancer therapy and has been shown to have the ability to bind with nucleophilic groups on the surface of tumor cells. Lofendazam also modulates the immune system by inhibiting inflammatory cytokines, such as IL-1β, IL-6, and TNF-α. The drug can be reconstituted with phosphate buffer for injection or topical use. Lofendazam has been shown to be effective in treating infectious diseases such as tuberculosis and inflammatory diseases such as rheumatoid arthritis.Formula:C15H13ClN2OPurity:Min. 95%Molecular weight:272.73 g/molLofendazam
CAS:Lofendazam (Bu 1014) is a benzodiazepine derivative that has sedative and anxiolytic effects.Formula:C15H13ClN2OPurity:97.28%Color and Shape:SolidMolecular weight:272.73


