CymitQuimica logo

CAS 29182-45-4

:

2-Benzothiazoleacetic acid

Description:
2-Benzothiazoleacetic acid is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring, with an acetic acid functional group attached. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. It exhibits properties that make it useful in various applications, including as a potential intermediate in organic synthesis and in the development of pharmaceuticals. The compound may also demonstrate biological activity, including antimicrobial or antifungal properties, which can be attributed to the benzothiazole moiety. Additionally, 2-benzothiazoleacetic acid can participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H6NO2S
InChI:InChI=1/C9H7NO2S/c11-9(12)5-8-10-6-3-1-2-4-7(6)13-8/h1-4H,5H2,(H,11,12)/p-1
InChI key:ZOAYQTSFMDZTQA-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nc(CC(=O)[O-])s2
Synonyms:
  • 1,3-Benzothiazol-2-ylacetic acid
  • 2-(1,3-Benzothiazol-2-Yl)Acetic Acid
  • 1,3-Benzothiazol-2-Ylacetate
Found 4 products.