CAS 29193-68-8

4-[(4-Chlorophenyl)sulfonyl]butanoic acid

Description:

4-[(4-Chlorophenyl)sulfonyl]butanoic acid, with the CAS number 29193-68-8, is an organic compound characterized by its sulfonyl group attached to a butanoic acid backbone. This compound features a chlorophenyl group, which contributes to its chemical properties and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The sulfonyl moiety enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in medicinal chemistry. The presence of the chlorine atom on the phenyl ring can influence the compound's electronic properties and biological interactions. As with many sulfonyl-containing compounds, it may exhibit interesting pharmacological activities, although specific biological data would depend on empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₁ClO₄S

InChI: InChI=1S/C10H11ClO4S/c11-8-3-5-9(6-4-8)16(14,15)7-1-2-10(12)13/h3-6H,1-2,7H2,(H,12,13)

InChI key: InChIKey=JTTKCIMZPMUDCT-UHFFFAOYSA-N

SMILES: S(CCCC(O)=O)(=O)(=O)C1=CC=C(Cl)C=C1

Synonyms:

• Butyric acid, 4-[(p-chlorophenyl)sulfonyl]-
• 4-[(4-Chlorophenyl)sulfonyl]butanoic acid
• Butanoic acid, 4-[(4-chlorophenyl)sulfonyl]-

4-(4-Chlorobenzenesulfonyl)butanoic acid

CAS: 29193-68-8

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClO₄S

Purity: Min. 95%

Molecular weight: 262.71 g/mol

Ref: 3D-EBA19368