
CAS 29198-41-2
:1,3-benzothiazol-2-ylmethylamine hydrochloride
Description:
1,3-Benzothiazol-2-ylmethylamine hydrochloride is a chemical compound characterized by its benzothiazole core, which features a fused benzene and thiazole ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in diverse applications. The presence of the amine group contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may be utilized in pharmaceutical research, particularly in the development of biologically active molecules, due to its potential interactions with biological systems. Additionally, it may exhibit properties such as fluorescence or antimicrobial activity, depending on its specific structure and substituents. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H9ClN2S
InChI:InChI=1/C8H8N2S.ClH/c9-5-8-10-6-3-1-2-4-7(6)11-8;/h1-4H,5,9H2;1H
SMILES:c1ccc2c(c1)nc(CN)s2.Cl
Synonyms:- 1-(1,3-Benzothiazol-2-Yl)Methanamine
- 1-(1,3-Benzothiazol-2-Yl)Methanamine Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(1,3-benzothiazol-2-yl)methanamine hydrochloride
CAS:Formula:C8H9ClN2SPurity:95%Color and Shape:SolidMolecular weight:200.68852-(Aminomethyl)-1,3-benzothiazole hydrochloride
CAS:2-(Aminomethyl)-1,3-benzothiazole hydrochloridePurity:≥95%Molecular weight:200.69g/molBenzo[d]thiazol-2-ylmethanamine hydrochloride
CAS:Formula:C8H9ClN2SPurity:95%Color and Shape:Solid, khaki powderMolecular weight:200.682-(Aminomethyl)-1,3-benzothiazole hydrochloride
CAS:Please enquire for more information about 2-(Aminomethyl)-1,3-benzothiazole hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H8N2S·HClPurity:Min. 95%Molecular weight:200.69 g/molRef: 3D-FA76419
Discontinued product



