CAS 29199-09-5: 3′,6′-Bis(diethylamino)-2-(4-nitrophenyl)spiro[1H-isoindole-1,9′-[9H]xanthen]-3(2H)-one
Description:3′,6′-Bis(diethylamino)-2-(4-nitrophenyl)spiro[1H-isoindole-1,9′-[9H]xanthen]-3(2H)-one is a synthetic organic compound characterized by its complex molecular structure, which includes a spiro linkage between an isoindole and a xanthenone moiety. This compound features two diethylamino groups that enhance its solubility and potential for interaction with biological systems. The presence of a nitrophenyl group contributes to its electronic properties, potentially making it useful in applications such as dyes or fluorescent markers. The spiro configuration indicates a unique three-dimensional arrangement that can influence its reactivity and stability. Typically, compounds of this nature may exhibit interesting photophysical properties, making them candidates for use in organic electronics or as fluorescent probes in biochemical assays. Additionally, the presence of multiple functional groups suggests potential for further chemical modification, which could expand its utility in various fields, including medicinal chemistry and materials science.
Formula:C34H34N4O4
InChI:InChI=1S/C34H34N4O4/c1-5-35(6-2)25-17-19-29-31(21-25)42-32-22-26(36(7-3)8-4)18-20-30(32)34(29)28-12-10-9-11-27(28)33(39)37(34)23-13-15-24(16-14-23)38(40)41/h9-22H,5-8H2,1-4H3
InChI key:InChIKey=XZXFZILEZWXEND-UHFFFAOYSA-N
SMILES:O=C1C=2C=CC=CC2C3(C4=CC=C(C=C4OC5=CC(=CC=C53)N(CC)CC)N(CC)CC)N1C6=CC=C(C=C6)N(=O)=O
- Synonyms:
- 3',6'-bis(diethylamino)-2-(4-nitrophenyl)spiro[isoindole-1,9'-xanthen]-3(2H)-one
- 3′,6′-Bis(diethylamino)-2-(4-nitrophenyl)spiro[1H-isoindole-1,9′-[9H]xanthen]-3(2H)-one
- 3′,6′-Bis(diethylamino)-2-(4-nitrophenyl)spiro[isoindole-1,9′-xanthene]-3-one
- 9-p-Nitroanilino-3,6-bis-diethylamino-9-xanthenyl-o-benzoic acid lactam
- Pink DCF
- Spiro[1H-isoindole-1,9′-[9H]xanthen]-3(2H)-one, 3′,6′-bis(diethylamino)-2-(4-nitrophenyl)-
- Spiro[isoindoline-1,9′-xanthene]-3-one, 3′,6′-bis(diethylamino)-2-(p-nitrophenyl)-
- 3',6'-Bis(diethylamino)-2-(4-nitrophenyl)spiro(1H-isoindole-1,9'-(9H)xanthene)-3(2H)-one

Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 3',6'-bis(diethylamino)-2-(4-nitrophenyl)-
Ref: IN-DA002XN9
5g | To inquire | ||
100mg | 97.00 € |

3',6'-Bis(diethylamino)-2-(4-nitrophenyl)spiro[isoindoline-1,9'-xanthen]-3-one
Ref: 10-F727458
5g | To inquire |

3',6'-Bis(diethylamino)-2-(4-nitrophenyl)spiro[isoindole-1,9'-xanthene]-3-one
Ref: 3B-B2628
25g | Discontinued | Request information |

3',6'-Bis(diethylamino)-2-(4-nitrophenyl)spiro[isoindole-1,9'-xanthene]-3-one
- Amines
- Nitro
- Ketones
- Pharmaceutical Standards
- See more categories
- Polycyclic Compounds
Ref: 3D-FB62564
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information | |
250g | Discontinued | Request information | |
500g | Discontinued | Request information |