CAS 29202-64-0: rutinose heptaacetate
Description:Rutinose heptaacetate is a chemical compound derived from rutin, a flavonoid glycoside, through the acetylation of its rutinose moiety. It is characterized by its complex structure, which includes multiple acetyl groups attached to the sugar component of the molecule. This modification enhances its solubility and stability compared to its parent compound. Rutinose heptaacetate typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but less so in water. Its molecular structure contributes to its potential biological activities, including antioxidant properties and possible applications in pharmaceuticals and food industries. The compound may also exhibit varying degrees of bioactivity, which can be influenced by its degree of acetylation. As with many acetylated compounds, it may undergo hydrolysis in biological systems, releasing rutin and acetic acid. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C26H36O17
InChI:InChI=1/C26H36O17/c1-10-19(36-11(2)27)21(38-13(4)29)23(40-15(6)31)25(35-10)34-9-18-20(37-12(3)28)22(39-14(5)30)24(41-16(7)32)26(43-18)42-17(8)33/h10,18-26H,9H2,1-8H3/t10-,18+,19-,20+,21+,22-,23+,24+,25+,26?/m0/s1