CAS 292053-56-6
:2-(4-Morpholinyl)-8-nitroquinoline
Description:
2-(4-Morpholinyl)-8-nitroquinoline is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with a nitro group and a morpholine ring. This compound typically exhibits properties associated with both the quinoline and morpholine moieties, such as potential biological activity and solubility in organic solvents. The presence of the nitro group can influence its reactivity and may contribute to its pharmacological properties. Morpholine, being a heterocyclic amine, can enhance the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. The compound may also display specific spectral characteristics in techniques like NMR and IR spectroscopy, aiding in its identification and characterization. Additionally, its potential applications could span various fields, including pharmaceuticals and materials science, depending on its biological activity and chemical stability. As with any chemical substance, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C13H13N3O3
InChI:InChI=1S/C13H13N3O3/c17-16(18)11-3-1-2-10-4-5-12(14-13(10)11)15-6-8-19-9-7-15/h1-5H,6-9H2
InChI key:InChIKey=NPRXCEZJOJIUJD-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C=CC(=N2)N3CCOCC3)C=CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.