CAS 2921-13-3
:(3R)-4-(dimethylamino)-3-hydroxybutanoic acid
Description:
(3R)-4-(Dimethylamino)-3-hydroxybutanoic acid, also known as DMHA, is an organic compound characterized by its amino acid structure. It features a chiral center, which contributes to its specific stereochemistry, denoted by the (3R) configuration. The presence of a dimethylamino group enhances its solubility in polar solvents and may influence its biological activity. This compound is a derivative of butanoic acid, containing both a hydroxyl group and an amino group, which are key functional groups that contribute to its reactivity and potential interactions in biological systems. DMHA is often studied for its role in metabolic processes and its potential applications in various fields, including pharmaceuticals and dietary supplements. Its properties include being a white crystalline solid at room temperature, with a relatively low molecular weight. As with many amino acid derivatives, it may exhibit both hydrophilic and lipophilic characteristics, making it versatile in chemical reactions and formulations. Safety and regulatory considerations are important when handling this compound, as with any chemical substance.
Formula:C6H13NO3
InChI:InChI=1/C6H13NO3/c1-7(2)4-5(8)3-6(9)10/h5,8H,3-4H2,1-2H3,(H,9,10)/t5-/m1/s1
SMILES:CN(C)C[C@@H](CC(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
L-Norcarnitine
CAS:Controlled ProductApplications L-Norcarnitine is a butyric acid derivative used in the preparation of L-Carnitine (C184110).
References Jain, R.P. et al.: Tetrahed. Lett., 42, 4437 (2001);Formula:C6H13NO3Color and Shape:NeatMolecular weight:147.17

