CAS 2921-20-2
:Tetradecylthioacetic acid
Description:
Tetradecylthioacetic acid is a long-chain fatty acid derivative characterized by its unique structure, which includes a tetradecyl (14-carbon) alkyl chain and a thioacetic acid functional group. This compound is typically a waxy solid at room temperature and is known for its hydrophobic properties due to the long hydrocarbon tail. It exhibits both acidic and thioether functionalities, making it a versatile compound in various chemical applications. Tetradecylthioacetic acid is often studied for its potential biological activities, including its role in lipid metabolism and its effects on cellular processes. Additionally, it may serve as a surfactant or emulsifying agent in formulations, enhancing the solubility of other compounds. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. As with many long-chain fatty acids, it is important to handle tetradecylthioacetic acid with care, considering its potential effects on health and the environment.
Formula:C16H32O2S
InChI:InChI=1S/C16H32O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-16(17)18/h2-15H2,1H3,(H,17,18)
InChI key:InChIKey=IPBCWPPBAWQYOO-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CCSCC(O)=O
Synonyms:- (Tetradecylsulfanyl)Acetic Acid
- 1-Mono(carboxymethylthio)tetradecane
- 2-(Tetradecylthio)acetic acid
- Acetic acid, (tetradecylthio)-
- Acetic acid, 2-(tetradecylthio)-
- Tetradcylthioacetic Acid
- Tetradecylthioacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Acetic acid, 2-(tetradecylthio)-
CAS:Formula:C16H32O2SPurity:98%Color and Shape:SolidMolecular weight:288.48912-(Tetradecylthio)Acetic Acid
CAS:2-(Tetradecylthio)Acetic AcidPurity:98%Molecular weight:288.50g/mol2-(Tetradecylthio)acetic Acid
CAS:Formula:C16H32O2SPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:288.49Tetradecylthioacetic acid
CAS:Synthetic fatty acid TTA has β-sulfur, resists β-oxidation, and activates PPARs, especially PPARα.
Formula:C16H32O2SPurity:99.93%Color and Shape:SolidMolecular weight:288.49Tetradecylthioacetic acid
CAS:Tetradecylthioacetic acid is a molecule that binds to the response element of the gene and inhibits the production of fatty acids, which are one of the main sources of energy for cells. Tetradecylthioacetic acid has been shown to inhibit mitochondrial functions in 3T3-L1 preadipocytes and dextran sulfate polymerase chain reaction. It also has an active effect on HIV-1 replication in HL-60 cells. Tetradecylthioacetic acid may be used as a treatment for cardiac diseases with heart failure or artery disease, such as balloon injury, because it can improve cardiac contractility and reduce arrhythmia.Formula:C16H32O2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:288.49 g/mol





