CymitQuimica logo

CAS 292140-76-2

:

3-(2-Benzothiazolyl)-2(1H)-pyridinone

Description:
3-(2-Benzothiazolyl)-2(1H)-pyridinone, identified by its CAS number 292140-76-2, is a chemical compound characterized by its unique structural features, which include a pyridinone core and a benzothiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the benzothiazole group may contribute to its ability to interact with biological targets, potentially influencing enzyme activity or receptor binding. Additionally, the compound may display fluorescence properties, which can be advantageous in various analytical applications. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or building block for more complex molecules in drug development. Overall, 3-(2-Benzothiazolyl)-2(1H)-pyridinone represents a versatile scaffold in the realm of chemical research, particularly in the search for novel therapeutic agents.
Formula:C12H8N2OS
InChI:InChI=1S/C12H8N2OS/c15-11-8(4-3-7-13-11)12-14-9-5-1-2-6-10(9)16-12/h1-7H,(H,13,15)
InChI key:InChIKey=YHMYUPKSHSZIIB-UHFFFAOYSA-N
SMILES:O=C1C(C2=NC=3C(S2)=CC=CC3)=CC=CN1
Synonyms:
  • 3-(2-Benzothiazolyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 3-(2-benzothiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.