CAS 29218-07-3

4-fluoro-4-deoxy-D-glucopyranose

Description:

4-Fluoro-4-deoxy-D-glucopyranose is a monosaccharide derivative of glucose, characterized by the substitution of a fluorine atom at the C-4 position, resulting in the absence of the hydroxyl group typically found in D-glucose. This modification alters its chemical properties and biological activity compared to its parent compound. The molecular formula of 4-fluoro-4-deoxy-D-glucopyranose reflects its structure, containing carbon, hydrogen, oxygen, and fluorine atoms. It exists predominantly in a pyranose form, which is a six-membered ring structure. This compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential role as a building block in the synthesis of fluorinated carbohydrates and its implications in drug design. The presence of the fluorine atom can enhance metabolic stability and alter the interaction with biological targets. As with many fluorinated compounds, it may exhibit unique properties such as increased lipophilicity or altered reactivity, making it a subject of study for its potential applications in pharmaceuticals and other chemical industries.

Formula: C₆H₁₁FO₅

InChI: InChI=1/C6H11FO5/c7-3-2(1-8)12-6(11)5(10)4(3)9/h2-6,8-11H,1H2

SMILES: C(C1C(C(C(C(O)O1)O)O)F)O

Synonyms:

• 4-Deoxy-4-fluoroglucose
• D-Glucose, 4-deoxy-4-fluoro-
• 4-deoxy-4-fluoro-D-glucopyranose
• 4-deoxy-4-fluoro-D-glucose
• 4-Deoxy-4-Fluorohexopyranose

D-Glucose, 4-deoxy-4-fluoro-

CAS: 29218-07-3

Formula: C₆H₁₁FO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 182.1469

Ref: IN-DA002XR1

4-Deoxy-4-fluoro-D-glucose

CAS: 29218-07-3

4-Deoxy-4-fluoro-D-glucose

Formula: C₆H₁₁FO₅

Purity: ≥95%

Color and Shape: white to off-white solid

Molecular weight: 182.15g/mol

Ref: 54-PC7308

4-Deoxy-4-fluoro-D-glucose

CAS: 29218-07-3

Molecular weight: 182.15

Ref: 7W-GC2830

4-Deoxy-4-fluoro-D-glucose

Controlled Product

CAS: 29218-07-3

Applications 4-Deoxy-4-fluoro-D-glucose (cas# 29218-07-3) is a compound useful in organic synthesis.

Formula: C₆H₁₁FO₅

Color and Shape: Neat

Molecular weight: 182.15

Ref: TR-D235100

4-Deoxy-4-fluoro-D-glucose

CAS: 29218-07-3

4-Deoxy-4-fluoro-D-glucose is a biochemical compound that is used to bind to the carbon source in target tissues. It has a fluorine atom and two hydroxy groups, which are responsible for its biological properties. 4-Deoxy-4-fluoro-D-glucose binds to the 6 phosphate in bacterial enzymes and inhibits their activity, leading to cell death. It also binds to the hydroxyl group of proteins and alters their function. 4-Deoxy-4-fluoro-D-glucose is an inhibitor of bacterial enzymes, but has no effect on eukaryotic cells due to its inability to bind with these types of enzymes.

Formula: C₆H₁₁FO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 182.15 g/mol

Ref: 3D-MD04720