CAS 2922-42-1
:(-)-3-Dehydroshikimic acid
Description:
(-)-3-Dehydroshikimic acid is a naturally occurring organic compound that belongs to the class of shikimic acid derivatives. It is characterized by its structural features, which include a bicyclic aromatic system and multiple hydroxyl groups, contributing to its polar nature. This compound is typically found in various plant species and is of interest due to its role in the biosynthesis of aromatic amino acids and secondary metabolites. (-)-3-Dehydroshikimic acid exhibits potential biological activities, including antiviral and anti-inflammatory properties, making it a subject of research in pharmacology and medicinal chemistry. The compound is often studied for its potential applications in drug development, particularly in the synthesis of antiviral agents. Its solubility in polar solvents and stability under standard laboratory conditions are notable characteristics, facilitating its use in various chemical reactions and biological assays. Overall, (-)-3-Dehydroshikimic acid represents an important compound in both natural product chemistry and pharmaceutical research.
Formula:C7H8O5
InChI:InChI=1S/C7H8O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,5-6,9-10H,2H2,(H,11,12)/t5-,6-/m1/s1
InChI key:InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-N
SMILES:C(O)(=O)C=1C[C@@H](O)[C@H](O)C(=O)C1
Synonyms:- (4S,5R)-4,5-Dihydroxy-3-oxo-1-cyclohexene-1-carboxylic acid
- 1-Cyclohexene-1-carboxylic acid, 4,5-dihydroxy-3-oxo-, (4S,5R)-
- 1-Cyclohexene-1-carboxylic acid, 4,5-dihydroxy-3-oxo-, (4S-trans)-
- 1-Cyclohexene-1-carboxylic acid, 4,5-dihydroxy-3-oxo-, trans-
- 4,5-Dihydroxy-3-Oxocyclohex-1-Ene-1-Carboxylic Acid
- 5-Dehydroshikimic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(-)-3-Dehydroshikimic acid
CAS:Formula:C7H8O5Purity:98%Color and Shape:SolidMolecular weight:172.1354(-)-3-Dehydro Shikimic Acid
CAS:Controlled ProductStability Temperature Sensitive
Applications A metabolite of Shikimic Acid.
References Lauhon, C.T. and Bartlett, P.A.: Biochemistry, 33, 14100 (1994), Balasubramanian, S., et al.: Biochemistry, 34, 341 (1995),Formula:C7H8O5Color and Shape:NeatMolecular weight:172.14(-)-3-Dehydro shikimic acid
CAS:(-)-3-Dehydro shikimic acid is a natural product that is an inhibitor of bacterial growth. It has been shown to inhibit the synthesis of aromatic amino acids, such as phenylalanine, tyrosine, and tryptophan from shikimate by binding to the enzyme 3-dehydroshikimate dehydrogenase (DHAS). The activity of DHAS is required for the production of other aromatic compounds in bacteria, such as protocatechuic acid. (-)-3-Dehydro shikimic acid also inhibits protein synthesis and polymerase chain reactions. This suggests that it may be a useful agent for treating bacterial infections. (-)-3-Dehydro shikimic acid has been shown to have pharmacokinetic properties that are similar to those of erythromycin and clindamycin, which are commonly used antibiotics.Formula:C7H8O5Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:172.14 g/mol






